| Name |
Glaucine O,O-Dimethylisoboldine S-(+)-Glaucine (+)-Glaucine |
| Formula |
C21H25NO4 |
| Mw |
355.17835829 |
| CAS RN |
475-81-0 |
| C_ID |
C00001861
, 
|
| InChIKey |
RUZIUYOSRDWYQF-GGYSOQFKNA-N |
| InChICode |
InChI=1S/C21H25NO4/c1-22-7-6-12-9-18(25-4)21(26-5)20-14-11-17(24-3)16(23-2)10-13(14)8-15(22)19(12)20/h9-11,15H,6-8H2,1-5H3/t15-/m0/s1 |
| SMILES |
COc1cc2c(cc1OC)-c1c(OC)c(OC)cc3c1[C@H](C2)N(C)CC3 |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Tyr L-Phe |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Annonaceae | Annona reticulata  | Ref. |
| Plantae | Annonaceae | Annona squamosa  | Ref. |
| Plantae | Annonaceae | Phoenicanthus obliqua | Ref. |
| Plantae | Annonaceae | Rollinia mucosa  | Ref. |
| Plantae | Annonaceae | Xylopia amazonica | Ref. |
| Plantae | Annonaceae | Xylopia aromatica  | Ref. |
| Plantae | Annonaceae | Xylopia laevigata | Ref. |
| Plantae | Annonaceae | Xylopia parviflora  | Ref. |
| Plantae | Berberidaceae | Berberis densiflora | Ref. |
| Plantae | Berberidaceae | Berberis integerrima | Ref. |
| Plantae | Berberidaceae | Berberis numularis | Ref. |
| Plantae | Berberidaceae | Berberis oblonga | Ref. |
| Plantae | Berberidaceae | Berberis turcomanica | Ref. |
| Plantae | Euphorbiaceae | Croton hemiargyreus | Ref. |
| Plantae | Euphorbiaceae | Croton lechleri  | Ref. |
| Plantae | Fumariaceae | Ceratocapnos palaestinus | Ref. |
| Plantae | Fumariaceae | Corydalis ambigua  | Ref. |
| Plantae | Fumariaceae | Corydalis bungeana  | Ref. |
| Plantae | Fumariaceae | Corydalis marchalliana | Ref. |
| Plantae | Fumariaceae | Dicentra eximia | Ref. |
| Plantae | Fumariaceae | Platycapnos saxicola | Ref. |
| Plantae | Fumariaceae | Platycapnos spicata | Ref. |
| Plantae | Fumariaceae | Platycapnos tenuiloba | Ref. |
| Plantae | Fumariaceae | Sarcocapnos baetica | Ref. |
| Plantae | Fumariaceae | Sarcocapnos enneaphylla | Ref. |
| Plantae | Fumariaceae | Sarcocapnos saetabensis | Ref. |
| Plantae | Lauraceae | Beilschmiedia podagrica | Ref. |
| Plantae | Lauraceae | Cryptocarya chinensis | Ref. |
| Plantae | Lauraceae | Neolitsea konishii | Ref. |
| Plantae | Lauraceae | Neolitsea parvigemma | Ref. |
| Plantae | Lauraceae | Ocotea vellosiana | Ref. |
| Plantae | Magnoliaceae | Liriodendron tulipifera  | Ref. |
| Plantae | Papaveraceae | Glaucium corniculatum  | Ref. |
| Plantae | Papaveraceae | Glaucium elegans | Ref. |
| Plantae | Papaveraceae | Glaucium flavum  | Ref. |
| Plantae | Papaveraceae | Glaucium grandiflorum | Ref. |
| Plantae | Ranunculaceae | Thalictrum flavum | Ref. |
| Plantae | Ranunculaceae | Thalictrum ichengense | Ref. |
| Plantae | Ranunculaceae | Thalictrum triternatum | Ref. |
| Plantae | Rutaceae | Zanthoxylum ailanthoides | Ref. |
|
|
zoom in
| Organism | Corydalis bungeana | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|