| Name |
D-Sucrose Sucrose (+)-Sucrose Saccharose |
| Formula |
C12H22O11 |
| Mw |
342.11621155 |
| CAS RN |
57-50-1 |
| C_ID |
C00001151
, 
|
| InChIKey |
CZMRCDWAGMRECN-PIZGLXSKNA-N |
| InChICode |
InChI=1S/C12H22O11/c13-1-4-6(16)8(18)9(19)11(21-4)23-12(3-15)10(20)7(17)5(2-14)22-12/h4-11,13-20H,1-3H2/t4-,5+,6+,7-,8-,9+,10+,11+,12-/m0/s1 |
| SMILES |
OCC1O[C@H](O[C@]2(CO)O[C@H](CO)C(O)[C@H]2O)C(O)[C@@H](O)[C@@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Animalia | Hominidae | Homo sapiens (Urine) | Ref. |
| Plantae | Anacardiaceae | Mangifera indica  | Ref. |
| Plantae | Annonaceae | Annona squamosa  | Ref. |
| Plantae | Annonaceae | Xylopia poilanei | Ref. |
| Plantae | Apiaceae | Apium graveolens  | Ref. |
| Plantae | Apiaceae | Notopterygium incisum  | Ref. |
| Plantae | Apiaceae | Petroselinum crispum  | Ref. |
| Plantae | Apiaceae | Pimpinella anisum L.  | Ref. |
| Plantae | Apiaceae | Saposhnikovia divaricata | Ref. |
| Plantae | Apocynaceae | Catharanthus roseus  | Ref. |
| Plantae | Apocynaceae | Marsdenia tomentosa | Ref. |
| Plantae | Araliaceae | Acanthopanax senticosus  | Ref. |
| Plantae | Araliaceae | Panax ginseng  | Ref. |
| Plantae | Araliaceae | Panax quinquefolium  | Ref. |
| Plantae | Asphodelaceae | Aloe vera  | Ref. |
| Plantae | Asteraceae | Helianthus annuus  | Ref. |
| Plantae | Asteraceae | Robinsonecio gerberifolius | Ref. |
| Plantae | Asteraceae | Stevia rebaudiana  | Ref. |
| Plantae | Asteraceae | Taraxacum officinale  | Ref. |
| Plantae | Cannabaceae | Humulus lupulus  | Ref. |
| Plantae | Caricaceae | Carica papaya  | Ref. |
| Plantae | Caryophyllales | Beta vulgaris  | Ref. |
| Plantae | Chenopodiaceae | Spinacia oleracea  | Ref. |
| Plantae | Crassulaceae | Rhodiola crenulata | Ref. |
| Plantae | Crassulaceae | Rhodiola kirilowii | Ref. |
| Plantae | Crassulaceae | Rhodiola rosea  | Ref. |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Cruciferae | Brassica oleracea  | Ref. |
| Plantae | Cruciferae | Isatis indigotica  | Ref. |
| Plantae | Cucurbitaceae | Cucumis sativus  | Ref. |
| Plantae | Dipsacaceae/Diervillaceae/Linnaeaceae/Valerianaceae | Dipsacus asperoides  | Ref. |
| Plantae | Fabaceae | Astragalus membranaceus  | Ref. |
| Plantae | Fabaceae | Astragalus mongholicus | Ref. |
| Plantae | Fabaceae | Caragana microphylla  | Ref. |
| Plantae | Fabaceae | Derris oblonga | Ref. |
| Plantae | Fabaceae | Genista corsica | Ref. |
| Plantae | Fabaceae | Glycine max  | Ref. |
| Plantae | Fabaceae | Medicago sativa  | Ref. |
| Plantae | Fabaceae | Phaseolus vulgaris  | Ref. |
| Plantae | Fabaceae | Vicia faba  | Ref. |
| Plantae | Ginkgoaceae | Ginkgo biloba  | Ref. |
| Plantae | Labiatae | Ajuga reptans  | Ref. |
| Plantae | Labiatae | Scutellaria baicalensis  | Ref. |
| Plantae | Liliaceae | Fritillaria unibracteata  | Ref. |
| Plantae | Lythraceae | Punica granatum  | Ref. |
| Plantae | Malvaceae | Gossypium hirsutum  | Ref. |
| Plantae | Melanthiaceae | Veratrum album  | Ref. |
| Plantae | Myrtaceae | Psidium guajava  | Ref. |
| Plantae | Orchidaceae | Gastrodia elata  | Ref. |
| Plantae | Paeoniaceae | Paeonia peregrina | Ref. |
| Plantae | Phyllanthaceae | Phyllanthus sellowianus | Ref. |
| Plantae | Pinaceae | Picea abies  | Ref. |
| Plantae | Plantaginaceae | Plantago asiatica  | Ref. |
| Plantae | Plantaginaceae | Plantago lanceolata  | Ref. |
| Plantae | Poaceae | Oryza sativa  | Ref. |
| Plantae | Poaceae | Saccharum officinarum  | Ref. |
| Plantae | Poaceae | Sorghum bicolor  | Ref. |
| Plantae | Poaceae | Triticum aestivum  | Ref. |
| Plantae | Poaceae | Zea mays  | Ref. |
| Plantae | Polypodiaceae | Pyrrosia lingua  | Ref. |
| Plantae | Polypodiaceae | Pyrrosia sheareri | Ref. |
| Plantae | Polytrichaceae | Polytrichum commune | Ref. |
| Plantae | Pteridaceae | Pteris multifida  | Ref. |
| Plantae | Rosaceae | Prunus avium  | Ref. |
| Plantae | Rubiaceae | Coffea arabica  | Ref. |
| Plantae | Rutaceae | Citrus sinensis  | Ref. |
| Plantae | Rutaceae | Murraya paniculata  | Ref. |
| Plantae | Rutaceae | Ruta graveolens  | Ref. |
| Plantae | Sapindaceae | Acer saccharum  | Ref. |
| Plantae | Sapotaceae | Sebertia acuminata | Ref. |
| Plantae | Solanaceae | Capsicum annuum  | Ref. |
| Plantae | Solanaceae | Nicotiana sylvestris | Ref. |
| Plantae | Solanaceae | Nicotiana tabacum  | Ref. |
| Plantae | Solanaceae | Solanum lycopersicum  | Ref. |
| Plantae | Solanaceae | Solanum tuberosum  | Ref. |
| Plantae | Symplocaceae | Symplocos caudata | Ref. |
| Plantae | Zingiberaceae | Curcuma domestica  | Ref. |
| - | - | Caffea sp. | Ref. |
|
|
zoom in
| Organism | Stevia rebaudiana | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|