| Name |
Ampelopsin
Dihydromyricetin
(2R,3R)-3,5,7,3',4',5'-Hexahydroxyflavanone
(+)-Ampelopsin |
| Formula |
C15H12O8 |
| Mw |
320.05321736 |
| CAS RN |
27200-12-0 |
| C_ID |
C00000938
, 
|
| InChIKey |
KJXSIXMJHKAJOD-PVRQQBJHNA-N |
| InChICode |
InChI=1S/C15H12O8/c16-6-3-7(17)11-10(4-6)23-15(14(22)13(11)21)5-1-8(18)12(20)9(19)2-5/h1-4,14-20,22H/t14-,15+/m0/s1 |
| SMILES |
O=C1c2c(O)cc(O)cc2O[C@H](c2cc(O)c(O)c(O)c2)[C@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asparagaceae | Asparagus officinalis  | Ref. |
| Plantae | Berberidaceae | Mahonia siamensis | Ref. |
| Plantae | Cercidiphyllaceae | Cercidiphyllum japonicum | Ref. |
| Plantae | Cruciferae | Brassica carinata Y line | Ref. |
| Plantae | Ericaceae | Rhododendron cinnabarinum | Ref. |
| Plantae | Ericaceae | Rhododendron spp. | Ref. |
| Plantae | Fabaceae | Adenanthera pavonina | Ref. |
| Plantae | Fabaceae | Intsia bijuga | Ref. |
| Plantae | Fabaceae | Medicago truncatula | Ref. |
| Plantae | Gentianaceae | Gentiana lutea L. var. aurantiaca | Ref. |
| Plantae | Ginkgoaceae | Ginkgo biloba | Ref. |
| Plantae | Lythraceae | Punica granatum L. | Ref. |
| Plantae | Meliaceae | Soymida febrifuga | Ref. |
| Plantae | Myrtaceae | Pimenta dioica | Ref. |
| Plantae | Myrtaceae | Syzygium cumini | Ref. |
| Plantae | Pinaceae | Cedrus deodara | Ref. |
| Plantae | Pinaceae | Picea abies | Ref. |
| Plantae | Pinaceae | Pinus spp. | Ref. |
| Plantae | Plantaginaceae | Antirrhinum majus | Ref. |
| Plantae | Poaceae | Zea mays | Ref. |
| Plantae | Rhamnaceae | Rhamnus pallasii | Ref. |
| Plantae | Rutaceae | Citrus incanus | Ref. |
| Plantae | Sapindaceae | Xanthoceras sorbifolia | Ref. |
| Plantae | Sapotaceae | Manilkara zapota cv.Tikal | Ref. |
| Plantae | Saxifragaceae | Heuchera villosa | Ref. |
| Plantae | Saxifragaceae | Leptarrhena pyrolifolia | Ref. |
| Plantae | Solanaceae | Capsicum annuum | Ref. |
| Plantae | Solanaceae | Petunia hybrida | Ref. |
| Plantae | Staphyleaceae | Euscaphis konishii | Ref. |
| Plantae | Taxaceae | Taxus chinensis | Ref. |
| Plantae | Theaceae | Camellia sinensis | Ref. |
| Plantae | Vitaceae | Ampelopsis meliaefolia | Ref. |
| Plantae | Vitaceae | Vitis rotundifolia | Ref. |
| - | - | Nympaea spp. | Ref. |
|
|
zoom in
| Organism | Pinus spp. |
|---|
| Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 711,Flavanones and dihydroflavonols
Kotake,Liebigs Ann.Chem.,544,(1940),253
Harborne,Phytochem.,10,(1971),2727 |
|---|
|
