| Name |
(E)-Ferulic acid E-Ferulic acid trans-Ferulic acid 4-Hydroxy-3-methoxy-(E)-cinnamic acid |
| Formula |
C10H10O4 |
| Mw |
194.05790881 |
| CAS RN |
537-98-4 |
| C_ID |
C00034325
, 
|
| InChIKey |
KSEBMYQBYZTDHS-HWKANZROSA-N |
| InChICode |
InChI=1S/C10H10O4/c1-14-9-6-7(2-4-8(9)11)3-5-10(12)13/h2-6,11H,1H3,(H,12,13)/b5-3+ |
| SMILES |
COc1cc(/C=C/C(=O)O)ccc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Apiaceae | Apium graveolens  | Ref. |
| Plantae | Brassicaceae | Wasabia japonica  | Ref. |
| Plantae | Chenopodiaceae | Spinacia oleracea  | Ref. |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Cruciferae | Raphanus sativus  | Ref. |
| Plantae | Cupressaceae | Chamaecyparis formosensis | Ref. |
| Plantae | Euphorbiaceae | Mallotus metcalfianus | Ref. |
| Plantae | Fabaceae | Pisum sativum  | Ref. |
| Plantae | Fabaceae | Sophora japonica  | Ref. |
| Plantae | Labiatae | Salvia officinalis  | Ref. |
| Plantae | Labiatae | Scutellaria albida subsp.albida | Ref. |
| Plantae | Piperaceae | Peperomia duclouxii C. DC. | Ref. |
| Plantae | Poaceae | Cymbopogon citratus  | Ref. |
| Plantae | Poaceae | Maize bran | Ref. |
| Plantae | Poaceae | Triticum aestivum  | Ref. |
| Plantae | Scrophulariaceae | Scrophularia buergeriana | Ref. |
| Plantae | Scrophulariaceae | Scrophularia huergeriana | Ref. |
| Plantae | Solanaceae | Solanum tuberosum  | Ref. |
| Plantae | Zingiberaceae | Curcuma domestica  | Ref. |
| - | - | Caffea sp. | Ref. |
|
|
zoom in
| Organism | Scrophularia huergeriana | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|