| Name |
Pomolic acid |
| Formula |
C30H48O4 |
| Mw |
472.35526002 |
| CAS RN |
13849-91-7 |
| C_ID |
C00031074
, 
|
| InChIKey |
ZZTYPLSBNNGEIS-FVVLLKQSNA-N |
| InChICode |
InChI=1S/C30H48O4/c1-18-10-15-30(24(32)33)17-16-27(5)19(23(30)29(18,7)34)8-9-21-26(4)13-12-22(31)25(2,3)20(26)11-14-28(21,27)6/h8,18,20-23,31,34H,9-17H2,1-7H3,(H,32,33)/t18-,20+,21-,22+,23-,26+,27-,28-,29-,30+/m1/s1 |
| SMILES |
C[C@@H]1CC[C@]2(C(=O)O)CC[C@]3(C)C(=CC[C@@H]4[C@@]5(C)CC[C@H](O)C(C)(C)[C@@H]5CC[C@]43C)[C@@H]2[C@]1(C)O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Aquifoliaceae | Ilex asprella | Ref. |
| Plantae | Aquifoliaceae | Ilex pubescens  | Ref. |
| Plantae | Araliaceae | Centella asiatica  | Ref. |
| Plantae | Ebenaceae | Diospyros kaki  | Ref. |
| Plantae | Labiatae | Perilla frutescens (L.) Britton var.japonica Hara  | Ref. |
| Plantae | Labiatae | Rosmarinus officinalis  | Ref. |
| Plantae | Labiatae | Salvia officinalis  | Ref. |
| Plantae | Labiatae | Salvia trijuga | Ref. |
| Plantae | Lamiaceae | Coleus aromaticus  | Ref. |
| Plantae | Myrtaceae | Syzygium buxifolium | Ref. |
| Plantae | Oleaceae | Olea europaea  | Ref. |
| Plantae | Rosaceae | Chaenomeles japonica  | Ref. |
| Plantae | Rosaceae | Duchesnea indica  | Ref. |
| Plantae | Rosaceae | Pyrus malus L.  | Ref. |
| Plantae | Rosaceae | Sanguisorba officinalis  | Ref. |
| Plantae | Verbenaceae | Lantana camara  | Ref. |
| - | - | Trogopterus xanthipes  | Ref. |
|
|
zoom in
| Organism | Trogopterus xanthipes | | Reference | Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979).
Zhou, et al., CCMM, 23, (1998), 164.
Huang, et al., CCMM, 22, (1997), 247.
Chen, et al., Lexicon of Active Componentsin in Plants, Vol1, Medicinal Science and Technology Press of China, Beijing, (2001).
Mimaki, et al., Phytochemistry, 57, (2001), 773 |
|---|
|