| Name |
O-Methylatheroline Oxoglaucine |
| Formula |
C20H17NO5 |
| Mw |
351.11067266 |
| CAS RN |
5574-24-3 |
| C_ID |
C00027457
, 
|
| InChIKey |
ZYKCETVKVRJFGD-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C20H17NO5/c1-23-13-8-11-12(9-14(13)24-2)19(22)18-16-10(5-6-21-18)7-15(25-3)20(26-4)17(11)16/h5-9H,1-4H3 |
| SMILES |
COc1cc2c(cc1OC)-c1c(OC)c(OC)cc3ccnc(c13)C2=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
Anthranilate |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Annonaceae | Annona cherimola  | Ref. |
| Plantae | Annonaceae | Annona purpurea  | Ref. |
| Plantae | Annonaceae | Fissistigma glaucescens  | Ref. |
| Plantae | Annonaceae | Rollinia mucosa  | Ref. |
| Plantae | Annonaceae | Xylopia aethiopica  | Ref. |
| Plantae | Annonaceae | Xylopia amazonica | Ref. |
| Plantae | Annonaceae | Xylopia vieillardi | Ref. |
| Plantae | Convallariaceae | Tupistra chinensis BAKER | Ref. |
| Plantae | Euphorbiaceae | Croton hemiargyreus | Ref. |
| Plantae | Fumariaceae | Platycapnos spicata | Ref. |
| Plantae | Fumariaceae | Sarcocapnos baetica | Ref. |
| Plantae | Fumariaceae | Sarcocapnos enneaphylla | Ref. |
| Plantae | Fumariaceae | Sarcocapnos saetabensis | Ref. |
| Plantae | Lauraceae | Neolitsea acuminatissima | Ref. |
| Plantae | Lauraceae | Neolitsea konishii | Ref. |
| Plantae | Lauraceae | Neolitsea parvigemma | Ref. |
| Plantae | Magnoliaceae | Liriodendron tulipifera  | Ref. |
| Plantae | Papaveraceae | Glaucium elegans | Ref. |
| Plantae | Papaveraceae | Glaucium flavum Crantz.  | Ref. |
| Plantae | Papaveraceae | Glaucium grandiflorum | Ref. |
| Plantae | Papaveraceae | Glaucium oxylobum | Ref. |
|
|
zoom in
| Organism | Liriodendron tulipifera | | Reference | Ji, et al., Pharmacological Action and Application of Available Antitumor Composition of Traditional Chinese Medicine, Heilongjiang Science and technology Press, Heilongjiang, (1998).
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998) |
|---|
|