| Name |
alpha-Santalene |
| Formula |
C15H24 |
| Mw |
204.18780077 |
| CAS RN |
512-61-8 |
| C_ID |
C00021850
, 
|
| InChIKey |
KWFJIXPIFLVMPM-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C15H24/c1-10(2)6-5-7-14(3)11-8-12-13(9-11)15(12,14)4/h6,11-13H,5,7-9H2,1-4H3/t11-,12+,13-,14-,15+/m0/s1 |
| SMILES |
CC(C)=CCCC1(C)C2CC3C(C2)C31C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Annonaceae | Xylopia rubescens | Ref. |
| Plantae | Apiaceae | Daucus carota  | Ref. |
| Plantae | Araliaceae | Panax ginseng  | Ref. |
| Plantae | Asteraceae | Echinops grijsii | Ref. |
| Plantae | Asteraceae | Petasites albus  | Ref. |
| Plantae | Asteraceae | Petasites hybridus  | Ref. |
| Plantae | Asteraceae | Petasites japonicus  | Ref. |
| Plantae | Labiatae | Lavandula angustifolia  | Ref. |
| Plantae | Lauraceae | Cinnamomum camphora  | Ref. |
| Plantae | Rutaceae | Atalantia buxifolia | Ref. |
| Plantae | Rutaceae | Clausena lansium  | Ref. |
| Plantae | Rutaceae | Severinia buxifolia  | Ref. |
| Plantae | Santalaceae | Osyris tenuifolia | Ref. |
| Plantae | Santalaceae | Santalum album  | Ref. |
| Plantae | Santalaceae | Santalum spicatum | Ref. |
| Plantae | Schisandraceae | Schisandra chinensis  | Ref. |
| Plantae | Zingiberaceae | Zingiber officinale  | Ref. |
| - | - | Lavandin abrialis | Ref. |
|
|
zoom in
| Organism | Zingiber officinale | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|