| Name |
Ellagic acid Gallogen Alizarin yellow Elagostasine |
| Formula |
C14H6O8 |
| Mw |
302.00626717 |
| CAS RN |
476-66-4 |
| C_ID |
C00011153
, 
|
| InChIKey |
AFSDNFLWKVMVRB-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C14H6O8/c15-5-1-3-7-8-4(14(20)22-11(7)9(5)17)2-6(16)10(18)12(8)21-13(3)19/h1-2,15-18H |
| SMILES |
O=c1oc2c(O)c(O)cc3c(=O)oc4c(O)c(O)cc1c4c23 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Anacardiaceae | Mangifera indica  | Ref. |
| Plantae | Asteraceae | Rhaponticum carthamoides  | Ref. |
| Plantae | Casuarinaceae | Casuarina cunninghamiana Miq. | Ref. |
| Plantae | Casuarinaceae | Casuarina equisetifolia L.  | Ref. |
| Plantae | Cistaceae | Cistus creticus | Ref. |
| Plantae | Combretaceae | Combretum yunnanensis | Ref. |
| Plantae | Combretaceae | Terminalia chebula  | Ref. |
| Plantae | Combretaceae | Terminalia superba  | Ref. |
| Plantae | Cunoniaceae | Cunonia macrophylla | Ref. |
| Plantae | Euphorbiaceae | Euphorbia hirta  | Ref. |
| Plantae | Euphorbiaceae | Macaranga barteri | Ref. |
| Plantae | Fabaceae | Acacia nilotica  | Ref. |
| Plantae | Fagaceae | Castanea sativa  | Ref. |
| Plantae | Fagaceae | Quercus alba  | Ref. |
| Plantae | Fagaceae | Quercus infectoria  | Ref. |
| Plantae | Fagaceae | Quercus robur  | Ref. |
| Plantae | Geraniaceae | Geranium sibiricum  | Ref. |
| Plantae | Geraniaceae | Geranium thunbergii | Ref. |
| Plantae | Haloragaceae | Myriophyllum spicatum | Ref. |
| Plantae | Juglandaceae | Platycarya strobilacea | Ref. |
| Plantae | Labiatae | Satureja subspicata  | Ref. |
| Plantae | Lythraceae | Lagerstroemia indica  | Ref. |
| Plantae | Lythraceae | Lythrum salicaria  | Ref. |
| Plantae | Lythraceae | Punica granatum  | Ref. |
| Plantae | Melastomataceae | Miconia myriantha | Ref. |
| Plantae | Meliaceae | Azadirachta indica  | Ref. |
| Plantae | Moringaceae | Moringa oleifera  | Ref. |
| Plantae | Moringaceae | Moringa peregrine | Ref. |
| Plantae | Moringaceae | Moringa stenopetala  | Ref. |
| Plantae | Myrtaceae | Eucalyptus citriodora  | Ref. |
| Plantae | Myrtaceae | Eugenia crebrinervis | Ref. |
| Plantae | Myrtaceae | Eugenia gustavioides | Ref. |
| Plantae | Myrtaceae | Eugenia jambolana  | Ref. |
| Plantae | Myrtaceae | Kunzea ambigua | Ref. |
| Plantae | Myrtaceae | Myrciaria cauliflora  | Ref. |
| Plantae | Myrtaceae | Psidium guajava  | Ref. |
| Plantae | Myrtaceae | Syzygium aromaticum  | Ref. |
| Plantae | Myrtaceae | Syzygium cumini  | Ref. |
| Plantae | Nymphaeaceae | Nymphaea alba  | Ref. |
| Plantae | Phyllanthaceae | Emblica officinalis  | Ref. |
| Plantae | Phyllanthaceae | Phyllanthus emblica  | Ref. |
| Plantae | Pinaceae | Pinus roxburghii  | Ref. |
| Plantae | Rosaceae | Agrimonia pilosa var.japonica  | Ref. |
| Plantae | Rosaceae | Cowania mexicana  | Ref. |
| Plantae | Rosaceae | Rubus idaeus L.  | Ref. |
| Plantae | Saxifragaceae | Saxifraga azizoon | Ref. |
| Plantae | Solanaceae | Capsicum annuum  | Ref. |
| Plantae | Taxaceae | Taxus chinensis | Ref. |
| Plantae | Taxodiaceae | Taxodium lanceolata | Ref. |
| Plantae | Valerianaceae/Linnaeaceae/Dipsacaceae/Diervillaceae | Valeriana officinalis  | Ref. |
| - | - | Aceraceae nikoense | Ref. |
| - | - | Chamaenerion angustifolium | Ref. |
| - | - | Flueggea microcarpa  | Ref. |
| - | - | terminalia bellirica | Ref. |
|
|
zoom in
| Organism | Geranium sibiricum | | Reference | Dell'Agli, et al., Planta Med, 69, (2003), 162.
Fogliani, et al., Phytochemistry, 66, (2005), 241.
Kiss, et al., Planta Med, 70, (2004), 919.
Asami, et al., Journal of Natural Products, 66, (2003), 729.
Buckingham(Executive Editor), Dictionary of Natural Products, Chapman & Hall, 1994, Vol1-7
1995, Vol8
1996, Vol9
1997, Vol10
1998, Vol11.
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979).
Guo, et al., Acta Pharmaceutica Sinica(Yaoxue Xuebao), 22, (1987), 28. |
|---|
|