| Name |
Isoschaftoside Apigenin 6-C-alpha-L-arabinopyranoside-8-C-beta-D-glucopyranoside Isoshaftoside |
| Formula |
C26H28O14 |
| Mw |
564.14790561 |
| CAS RN |
52012-29-0 |
| C_ID |
C00006381
, 
|
| InChIKey |
OVMFOVNOXASTPA-WCGZTJJSNA-N |
| InChICode |
InChI=1S/C26H28O14/c27-6-13-18(32)21(35)23(37)26(40-13)16-20(34)15(25-22(36)17(31)11(30)7-38-25)19(33)14-10(29)5-12(39-24(14)16)8-1-3-9(28)4-2-8/h1-5,11,13,17-18,21-23,25-28,30-37H,6-7H2/t11-,13+,17-,18+,21-,22-,23+,25-,26-/m0/s1 |
| SMILES |
O=c1cc(-c2ccc(O)cc2)oc2c([C@@H]3OC(CO)[C@@H](O)[C@H](O)C3O)c(O)c([C@@H]3OC[C@H](O)[C@H](O)C3O)c(O)c12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Araceae | Colocasia esculenta  | Ref. |
| Plantae | Araceae | Colocasia escultenta | Ref. |
| Plantae | Asteraceae | Artemisia consanguineum | Ref. |
| Plantae | Asteraceae | Artemisia heterophyllum | Ref. |
| Plantae | Asteraceae | Artemisia spp.  | Ref. |
| Plantae | Asteraceae | Baccharis gaudichaudiana DC | Ref. |
| Plantae | Asteraceae | Catananche caerulea | Ref. |
| Plantae | Asteraceae | Flourensia cernua | Ref. |
| Plantae | Caryophyllaceae | Stellaria media  | Ref. |
| Plantae | Fabaceae | Glycine max  | Ref. |
| Plantae | Fabaceae | Glycyrrhiza glabra  | Ref. |
| Plantae | Fabaceae | Glycyrrhiza inflata  | Ref. |
| Plantae | Fabaceae | Glycyrrhiza uralensis  | Ref. |
| Plantae | Fabaceae | Lespedeza capitata | Ref. |
| Plantae | Fabaceae | Vicia faba  | Ref. |
| Plantae | Labiatae | Scutellaria baicalensis  | Ref. |
| Plantae | Poaceae | Arrhenatherum spp. | Ref. |
| Plantae | Poaceae | Cymbopogon citratus  | Ref. |
| Plantae | Rosaceae | Crataegus monogyna L.  | Ref. |
| Plantae | Rosaceae | Cydonia oblonga  | Ref. |
| Plantae | Solanaceae | Capsicum annum L. | Ref. |
| Plantae | Solanaceae | Capsicum annuum  | Ref. |
| Plantae | Theaceae | Camellia sinensis (L.) O.KUNTZE  | Ref. |
| Plantae | Violaceae | Viola yedoensis | Ref. |
|
|
zoom in
| Organism | Arrhenatherum spp. | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 549,C-glycosylflavones
Dilon, Phytochem.,15,(1976),1085 |
|---|
|