| Name |
Arbutin beta-Arbutin |
| Formula |
C12H16O7 |
| Mw |
272.08960287 |
| CAS RN |
497-76-7 |
| C_ID |
C00002638
, 
|
| InChIKey |
BJRNKVDFDLYUGJ-MXWMHPLRNA-N |
| InChICode |
InChI=1S/C12H16O7/c13-5-8-9(15)10(16)11(17)12(19-8)18-7-3-1-6(14)2-4-7/h1-4,8-17H,5H2/t8-,9-,10+,11-,12-/m1/s1 |
| SMILES |
OCC1O[C@@H](Oc2ccc(O)cc2)C(O)[C@@H](O)[C@@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Bacteria | Enterobacteriaceae | Escherichia coli | Ref. |
| Plantae | Apiaceae | Angelica furcijuga KITAGAWA | Ref. |
| Plantae | Crassulaceae | Sedum takesimense Nakai | Ref. |
| Plantae | Ericaceae | Arctostaphylos uva-ursi  | Ref. |
| Plantae | Ericaceae | Rhododendron ferrugineum  | Ref. |
| Plantae | Ericaceae | Rhododendron ponticum | Ref. |
| Plantae | Ericaceae | Vaccinium vitis-idaea  | Ref. |
| Plantae | Fabaceae | Onobrychis bobrovi | Ref. |
| Plantae | Labiatae | Origanum majorana  | Ref. |
| Plantae | Phyllanthaceae | Breynia officinalis | Ref. |
| Plantae | Plantaginaceae | Adenosma caeruleum | Ref. |
| Plantae | Plantaginaceae | Veronica turrilliana | Ref. |
| Plantae | Rosaceae | Cotoneaster simonsii | Ref. |
| Plantae | Rosaceae | Pyrus communis  | Ref. |
| Plantae | Salicaceae | Salix acmophylla  | Ref. |
| Plantae | Saxifragaceae | Bergenia crassifolia | Ref. |
| Plantae | Turneraceae | Turnera diffusa  | Ref. |
| Plantae | Turneraceae | Turnera subulata | Ref. |
|
|
zoom in
| Organism | Turnera diffusa | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|