| Name |
Glucoconringiin 2-Hydroxy-2-methylpropyl glucosinolate |
| Formula |
C11H21NO10S2 |
| Mw |
391.06068736 |
| CAS RN |
28463-28-7 |
| C_ID |
C00001469
, 
|
| InChIKey |
DYAQCRHEYVANDL-MOASJWAZNA-N |
| InChICode |
InChI=1S/C11H21NO10S2/c1-11(2,17)3-6(12-22-24(18,19)20)23-10-9(16)8(15)7(14)5(4-13)21-10/h5,7-10,13-17H,3-4H2,1-2H3,(H,18,19,20)/b12-6+/t5-,7+,8-,9+,10+/m0/s1 |
| SMILES |
CC(C)(O)C/C(=N/OS(=O)(=O)O)S[C@H]1OC(CO)[C@H](O)C(O)[C@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-His Cholesterol |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Akaniaceae | Bretschneidera sinensis | Ref. |
| Plantae | Brassicaceae | Dentaria laciniata | Ref. |
| Plantae | Capparaceae | Cleome diandra | Ref. |
| Plantae | Cruciferae | Capsella cordifolia | Ref. |
| Plantae | Cruciferae | Cochlearia anglica | Ref. |
| Plantae | Cruciferae | Cochlearia danica | Ref. |
| Plantae | Cruciferae | Cochlearia officinalis  | Ref. |
| Plantae | Cruciferae | Conringia orientalis | Ref. |
| Plantae | Cruciferae | Conringia spp. | Ref. |
| Plantae | Cruciferae | Nasturtiopsis arabica | Ref. |
| Plantae | Cruciferae | Sisymbrium crassifolium  | Ref. |
| Plantae | Cruciferae | Sisymbrium polyceratium | Ref. |
| Plantae | Cruciferae | Thlaspi alpestre | Ref. |
| Plantae | Cruciferae | Thlaspi qvalanum | Ref. |
| Plantae | Limnanthaceae | Limnanthes alba | Ref. |
| Plantae | Moringaceae | Moringa oleifera  | Ref. |
| Plantae | Moringaceae | Moringa peregrine | Ref. |
| Plantae | Moringaceae | Moringa stenopetala  | Ref. |
| Plantae | Resedaceae | Reseda alba | Ref. |
| Plantae | Tropaeolaceae | Tropaeolum peregrinum | Ref. |
|
|
zoom in
| Organism | Moringa peregrine | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|