| Name |
Cirsiliol |
| Formula |
C17H14O7 |
| Mw |
330.0739528 |
| CAS RN |
34334-69-5 |
| C_ID |
C00001033
, 
|
| InChIKey |
IMEYGBIXGJLUIS-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C17H14O7/c1-22-14-7-13-15(16(21)17(14)23-2)11(20)6-12(24-13)8-3-4-9(18)10(19)5-8/h3-7,18-19,21H,1-2H3 |
| SMILES |
COc1cc2oc(-c3ccc(O)c(O)c3)cc(=O)c2c(O)c1OC |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Ageratina havanensis | Ref. |
| Plantae | Asteraceae | Artemisia annua  | Ref. |
| Plantae | Asteraceae | Centaurea gigantea | Ref. |
| Plantae | Asteraceae | Cirsium lineare | Ref. |
| Plantae | Fabaceae | Pisum sativum  | Ref. |
| Plantae | Labiatae | Salvia columbariae  | Ref. |
| Plantae | Labiatae | Salvia dorrii | Ref. |
| Plantae | Labiatae | Salvia guranitica | Ref. |
| Plantae | Labiatae | Salvia hypoleuca | Ref. |
| Plantae | Labiatae | Salvia lavandulaefolia | Ref. |
| Plantae | Labiatae | Salvia macrosiphon | Ref. |
| Plantae | Labiatae | Salvia officinalis  | Ref. |
| Plantae | Labiatae | Salvia stenophylla  | Ref. |
| Plantae | Labiatae | Salvia verbenaca  | Ref. |
| Plantae | Labiatae | Teucrium gnaphalodes | Ref. |
| Plantae | Verbenaceae | Lantana fucata  | Ref. |
| Plantae | Verbenaceae | Lippia citriodora  | Ref. |
|
|
zoom in
| Organism | Lippia citriodora | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 2.Flavones, John Wiley & Son
Brieskorn,Arch.Pharm.(Weinheim),304,(1971),557
Barberan,J.Nat.Prod.,48,(1985),859 |
|---|
|