| Name |
Epicatechin gallate |
| Formula |
C22H18O10 |
| Mw |
442.0899968 |
| CAS RN |
863-03-6 |
| C_ID |
C00053146
|
| InChIKey |
LSHVYAFMTMFKBA-FPOVZHCZSA-N |
| InChICode |
InChI=1S/C22H18O10/c23-11-6-14(25)12-8-19(32-22(30)10-4-16(27)20(29)17(28)5-10)21(31-18(12)7-11)9-1-2-13(24)15(26)3-9/h1-7,19,21,23-29H,8H2/t19-,21-/m0/s1 |
| SMILES |
O=C(O[C@H]1Cc2c(O)cc(O)cc2O[C@H]1c1ccc(O)c(O)c1)c1cc(O)c(O)c(O)c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Annonaceae | Annona muricata | Ref. |
| Plantae | Crassulaceae | Rhodiola crenulata | Ref. |
| Plantae | Ericaceae | Rhododendron brachycarpum ssp.brachycarpum | Ref. |
| Plantae | Ericaceae | Rhododendron calophytum | Ref. |
| Plantae | Ericaceae | Rhododendron catawbiense | Ref. |
| Plantae | Ericaceae | Rhododendron Cunningham's white | Ref. |
| Plantae | Ericaceae | Rhododendron degronianum ssp. Heptamerum var. hondoense | Ref. |
| Plantae | Ericaceae | Rhododendron dichroanthum ssp.scyphocalyx | Ref. |
| Plantae | Ericaceae | Rhododendron fortunei | Ref. |
| Plantae | Ericaceae | Rhododendron ponticum | Ref. |
| Plantae | Ericaceae | Rhododendron praevernum | Ref. |
| Plantae | Ericaceae | Rhododendron smirnowii | Ref. |
| Plantae | Ericaceae | Rhododendron ungernii | Ref. |
| Plantae | Ginkgoaceae | Ginkgo biloba | Ref. |
| Plantae | Lythraceae | Punica granatum | Ref. |
| Plantae | Polygonaceae | Rumex vesicarius | Ref. |
|
|
zoom in
| Organism | Rumex vesicarius | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|