| Name |
Isoamyl alcohol |
| Formula |
C5H12O |
| Mw |
88.08881501 |
| CAS RN |
123-51-3 |
| C_ID |
C00050468
|
| InChIKey |
PHTQWCKDNZKARW-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C5H12O/c1-5(2)3-4-6/h5-6H,3-4H2,1-2H3 |
| SMILES |
CC(C)CCO |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Bacteria | Enterobacteriaceae | Escherichia coli | Ref. |
| Plantae | Anacardiaceae | Mangifera indica  | Ref. |
| Plantae | Caricaceae | Carica papaya  | Ref. |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia dulcis  | Ref. |
| Plantae | Cornaceae/Aucubaceae/Garryaceae/Helwingiaceae | Cornus officinalis  | Ref. |
| Plantae | Cruciferae | Capsella bursa-pastoris  | Ref. |
| Plantae | Fabaceae | Medicago sativa  | Ref. |
| Plantae | Lauraceae | Litsea cubeba  | Ref. |
| Plantae | Lythraceae | Punica granatum  | Ref. |
| Plantae | Rosaceae | Rosa rugosa  | Ref. |
| Plantae | Rubiaceae | Coffea arabica  | Ref. |
| Plantae | Solanaceae | Nicotiana tabacum  | Ref. |
| Plantae | Solanaceae | Solanum lycopersicum  | Ref. |
| Plantae | Zingiberaceae | Zingiber officinale  | Ref. |
| - | - | Caffea sp. | Ref. |
| - | - | Carnus officinalis | Ref. |
| - | - | FOOD SAKE | Ref. |
|
|
zoom in
| Organism | Carnus officinalis | | Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Dobson, et al., Phytochemistry, 26, (1987), 3171 |
|---|
|