| Name |
beta-Copaene |
| Formula |
C15H24 |
| Mw |
204.18780077 |
| CAS RN |
18252-44-3 |
| C_ID |
C00048329
, 
|
| InChIKey |
UPVZPMJSRSWJHQ-VVHJHXJGNA-N |
| InChICode |
InChI=1S/C15H24/c1-9(2)11-7-8-15(4)12-6-5-10(3)14(15)13(11)12/h9,11-14H,3,5-8H2,1-2,4H3/t11-,12+,13+,14-,15-/m1/s1 |
| SMILES |
C=C1CCC2C3C(C(C)C)CC[C@@]2(C)[C@H]13 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Annonaceae | Xylopia parviflora  | Ref. |
| Plantae | Apiaceae | Foeniculum vulgare  | Ref. |
| Plantae | Asteraceae | Ambrosia trifida | Ref. |
| Plantae | Asteraceae | Centaurea atropurpurea | Ref. |
| Plantae | Asteraceae | Phagnalon sordidum | Ref. |
| Plantae | Cannabaceae | Humulus lupulus  | Ref. |
| Plantae | Cistaceae | Cistus creticus | Ref. |
| Plantae | Labiatae | Satureja subspicata  | Ref. |
| Plantae | Lauraceae | Litsea cubeba  | Ref. |
| Plantae | Myrtaceae | Leptospermum scoparium  | Ref. |
| Plantae | Myrtaceae | Psidium guajava  | Ref. |
| Plantae | Pinaceae | Cedrus libani  | Ref. |
| Plantae | Pinaceae | Pinus halepensis  | Ref. |
| Plantae | Piperaceae | Piper nigrum  | Ref. |
| Plantae | Plantaginaceae | Veronica spicata | Ref. |
| Plantae | Primulaceae | Primula halleri | Ref. |
| Plantae | Rutaceae | Citrus retuculata | Ref. |
| Plantae | Solanaceae | Solanum lycopersicum  | Ref. |
| Plantae | Zingiberaceae | Curcuma amada  | Ref. |
| Plantae | Zingiberaceae | Curcuma amanda Roxb | Ref. |
| Plantae | Zingiberaceae | Zingiber officinale  | Ref. |
|
|
zoom in
| Organism | Primula halleri | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|