| Name |
2-Tridecanone |
| Formula |
C13H26O |
| Mw |
198.19836545 |
| CAS RN |
593-08-8 |
| C_ID |
C00036263
, 
|
| InChIKey |
CYIFVRUOHKNECG-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C13H26O/c1-3-4-5-6-7-8-9-10-11-12-13(2)14/h3-12H2,1-2H3 |
| SMILES |
CCCCCCCCCCCC(C)=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Cannabaceae | Humulus lupulus  | Ref. |
| Plantae | Caricaceae | Carica papaya  | Ref. |
| Plantae | Cistaceae | Cistus creticus | Ref. |
| Plantae | Jubulaceae | Frullania solanderiana | Ref. |
| Plantae | Juncaceae | Juncus effusus  | Ref. |
| Plantae | Meliaceae | Azadirachta indica  | Ref. |
| Plantae | Myrtaceae | Acca sellowiana | Ref. |
| Plantae | Poaceae | Cymbopogon citratus  | Ref. |
| Plantae | Rosaceae | Rosa rugosa  | Ref. |
| Plantae | Rosaceae | Sorbus tianschanica | Ref. |
| Plantae | Rutaceae | Esenbeckia yaxhoob Lundell | Ref. |
| Plantae | Rutaceae | Ruta graveolens  | Ref. |
| Plantae | Rutaceae | Zanthoxylum armatum  | Ref. |
| Plantae | Rutaceae | Zanthoxylum integrifoliolum | Ref. |
| Plantae | Saururaceae | Houttuynia cordata  | Ref. |
| Plantae | Solanaceae | Nicotiana tabacum  | Ref. |
|
|
zoom in
| Organism | Nicotiana tabacum | | Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
|---|
|