| Name |
trans-Furanoid linalool oxide trans-Linalool oxide E-Furanoid linalool oxide |
| Formula |
C10H18O2 |
| Mw |
170.13067982 |
| CAS RN |
34995-77-2 |
| C_ID |
C00034496
, 
|
| InChIKey |
BRHDDEIRQPDPMG-MNLQIPBYNA-N |
| InChICode |
InChI=1S/C10H18O2/c1-5-10(4)7-6-8(12-10)9(2,3)11/h5,8,11H,1,6-7H2,2-4H3/t8-,10+/m0/s1 |
| SMILES |
C=C[C@]1(C)CC[C@@H](C(C)(C)O)O1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Acoraceae | Acorus calamus  | Ref. |
| Plantae | Anacardiaceae | Mangifera indica  | Ref. |
| Plantae | Asteraceae | Chamaemelum nobile  | Ref. |
| Plantae | Asteraceae | Matricaria recutita  | Ref. |
| Plantae | Caricaceae | Carica papaya  | Ref. |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia dulcis  | Ref. |
| Plantae | Cornaceae/Aucubaceae/Garryaceae/Helwingiaceae | Cornus officinalis  | Ref. |
| Plantae | Crassulaceae | Rhodiola rosea  | Ref. |
| Plantae | Cruciferae | Hesperis matronalis  | Ref. |
| Plantae | Labiatae | Cunila angustifolia | Ref. |
| Plantae | Labiatae | Lavandula angustifolia  | Ref. |
| Plantae | Labiatae | Ocimum basilicum  | Ref. |
| Plantae | Labiatae | Perilla frutescens  | Ref. |
| Plantae | Lauraceae | Cinnamomum camphora  | Ref. |
| Plantae | Rutaceae | Citrus sinensis  | Ref. |
| Plantae | Salicaceae | Salix babylonica  | Ref. |
| Plantae | Solanaceae | Solanum lycopersicum  | Ref. |
| Plantae | Theaceae | Camellia sinensis  | Ref. |
| Plantae | Turneraceae | Turnera diffusa  | Ref. |
| - | - | Lavandin abrialis | Ref. |
|
|
zoom in
| Organism | Salix babylonica | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|