| Name |
Leucosceptoside A |
| Formula |
C30H38O15 |
| Mw |
638.22107055 |
| CAS RN |
83529-62-8 |
| C_ID |
C00030657
, 
|
| InChIKey |
ZMYQRHSOVRDQDL-KVEOLEFTNA-N |
| InChICode |
InChI=1S/C30H38O15/c1-14-23(36)24(37)25(38)30(42-14)45-28-26(39)29(41-10-9-16-3-6-17(32)19(34)11-16)43-21(13-31)27(28)44-22(35)8-5-15-4-7-18(33)20(12-15)40-2/h3-8,11-12,14,21,23-34,36-39H,9-10,13H2,1-2H3/b8-5+/t14-,21+,23-,24+,25+,26+,27+,28+,29+,30-/m0/s1 |
| SMILES |
COc1cc(/C=C/C(=O)O[C@H]2[C@H](O[C@@H]3O[C@@H](C)[C@H](O)[C@@H](O)[C@H]3O)[C@@H](O)[C@H](OCCc3ccc(O)c(O)c3)O[C@@H]2CO)ccc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Acanthaceae | Acanthus ebracteatus | Ref. |
| Plantae | Bignoniaceae | Barnettia kerrii | Ref. |
| Plantae | Bignoniaceae | Fernandoa adenophylla | Ref. |
| Plantae | Buddlejaceae | Buddleja davidii | Ref. |
| Plantae | Globulariaceae | Globularia davisiana | Ref. |
| Plantae | Labiatae | Clerodendrum inerme  | Ref. |
| Plantae | Labiatae | Lamium purpureum L.  | Ref. |
| Plantae | Labiatae | Leonurus persicus | Ref. |
| Plantae | Labiatae | Leucosceptrum japonicum | Ref. |
| Plantae | Labiatae | Marrubium velutinum | Ref. |
| Plantae | Labiatae | Scutellaria baicalensis  | Ref. |
| Plantae | Malvaceae | Firmiana platanifolia | Ref. |
| Plantae | Orobanchaceae | Pedicularis nordmanniana | Ref. |
| Plantae | Orobanchaceae | Phtheirospermum japonicum | Ref. |
| Plantae | Plantaginaceae | Plantago asiatica  | Ref. |
| Plantae | Plantaginaceae | Plantago lanceolata  | Ref. |
| Plantae | Scrophulariaceae | Rehmannia glutinosa  | Ref. |
| Plantae | Verbenaceae | Verbena brasiliensis VELL | Ref. |
|
|
zoom in
| Organism | Plantago lanceolata | | Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Zhang, et al., Natural Product Research and Development(Tianran Chanwu Yanjiu Yu Kaifa), 15, (2003), 162.
Budzianowska, et al., Planta Med, 70, (2004), 834.
Sahin, et al., Phytochemistry, 65, (2004), 2095 |
|---|
|