| Name |
Mussaenosidic acid |
| Formula |
C16H24O10 |
| Mw |
376.13694699 |
| CAS RN |
82451-22-7 |
| C_ID |
C00010629
, 
|
| InChIKey |
VLCHQFXSBHIBRV-WCQHRLGTNA-N |
| InChICode |
InChI=1S/C16H24O10/c1-16(23)3-2-6-7(13(21)22)5-24-14(9(6)16)26-15-12(20)11(19)10(18)8(4-17)25-15/h5-6,8-12,14-15,17-20,23H,2-4H2,1H3,(H,21,22)/t6-,8-,9-,10-,11-,12+,14+,15-,16+/m1/s1 |
| SMILES |
C[C@]1(O)CC[C@@H]2C(C(=O)O)=COC(O[C@H]3OC(CO)[C@@H](O)C(O)[C@@H]3O)[C@@H]21 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Globulariaceae | Globularia vulgaris L. | Ref. |
| Plantae | Labiatae | Vitex agnus-castus  | Ref. |
| Plantae | Orobanchaceae | Cistanche deserticola  | Ref. |
| Plantae | Orobanchaceae | Cistanche salsa | Ref. |
| Plantae | Orobanchaceae | Cistanche tubulosa  | Ref. |
| Plantae | Orobanchaceae | Melampyrum cristatum | Ref. |
| Plantae | Orobanchaceae | Pedicularis longiflora var. tubiformis | Ref. |
| Plantae | Orobanchaceae | Pedicularis muscicola | Ref. |
| Plantae | Plantaginaceae | Kickxia abhaica D.A Sutton | Ref. |
| Plantae | Plantaginaceae | Plantago alpina | Ref. |
| Plantae | Plantaginaceae | Plantago arborescens | Ref. |
| Plantae | Plantaginaceae | Plantago nivalis | Ref. |
| Plantae | Plantaginaceae | Plantago sempervirens | Ref. |
| Plantae | Plantaginaceae | Plantago webbii | Ref. |
| Plantae | Plantaginaceae | Veronica beccabunga  | Ref. |
| Plantae | Plantaginaceae | Veronica derwentiana | Ref. |
| Plantae | Plantaginaceae | Veronica perfoliata | Ref. |
| Plantae | Plantaginaceae | Wulfenia orientalis BOISS. | Ref. |
| Plantae | Rubiaceae | Adina polycephala Benth | Ref. |
| Plantae | Rubiaceae | Gardenia jasminoides  | Ref. |
| Plantae | Scrophulariaceae | Camptoloma lyperiiflorum (Vatke) Hillard | Ref. |
| Plantae | Scrophulariaceae | Rehmannia glutinosa  | Ref. |
| - | - | Baleria lupulina | Ref. |
|
|
zoom in
| Organism | Veronica derwentiana | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|