| Name |
Sotetsuflavone |
| Formula |
C31H20O10 |
| Mw |
552.10564686 |
| CAS RN |
2608-21-1 |
| C_ID |
C00006489
, 
|
| InChIKey |
OIFVLHZEBAXHPM-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C31H20O10/c1-39-26-13-23(38)30-22(37)12-24(14-2-5-16(32)6-3-14)41-31(30)28(26)18-8-15(4-7-19(18)34)25-11-21(36)29-20(35)9-17(33)10-27(29)40-25/h2-13,32-35,38H,1H3 |
| SMILES |
COc1cc(O)c2c(=O)cc(-c3ccc(O)cc3)oc2c1-c1cc(-c2cc(=O)c3c(O)cc(O)cc3o2)ccc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Araucariaceae | Araucaria spp. | Ref. |
| Plantae | Cephalotaxaceae | Amentotaxus yunnanensis | Ref. |
| Plantae | Cycadaceae | Cycas revoluta  | Ref. |
| Plantae | Cycadaceae | Cycas spp. | Ref. |
| Plantae | Podocarpaceae | Dacrydium spp. | Ref. |
| Plantae | Podocarpaceae | Falcatifolium spp. | Ref. |
| Plantae | Podocarpaceae | Halocarpus spp. | Ref. |
| Plantae | Podocarpaceae | Lagarostrobos spp. | Ref. |
| Plantae | Podocarpaceae | Lepidothamnus spp. | Ref. |
| Plantae | Taxaceae | Taxus baccata  | Ref. |
| Plantae | Taxaceae | Taxus cuspidata  | Ref. |
| Plantae | Taxaceae | Taxus spp. | Ref. |
| Plantae | Taxaceae | Torreya yunnanensis | Ref. |
| Plantae | Taxodiaceae | Cunninghamia spp. | Ref. |
| Plantae | Taxodiaceae | Metasequoia glyptostroboides | Ref. |
| Plantae | Zamiaceae | Microcycas spp. | Ref. |
| - | - | Selaginella tamariscina  | Ref. |
|
|
zoom in
| Organism | Microcycas spp. | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 645,Biflavonyls
Beckmann,Phytochem.,10,(1971),2465
Ilyas,Phytochem.,17,(1978),987 |
|---|
|