| Name |
Kaempferol 3-glucuronide Kaempferol-3-O-beta-D-glucuronide Kaempferol-3-beta-D-glucuronide |
| Formula |
C21H18O12 |
| Mw |
462.07982604 |
| CAS RN |
22688-78-4 |
| C_ID |
C00005141
, 
|
| InChIKey |
FNTJVYCFNVUBOL-NTEJZTTHNA-N |
| InChICode |
InChI=1S/C21H18O12/c22-8-3-1-7(2-4-8)17-18(13(25)12-10(24)5-9(23)6-11(12)31-17)32-21-16(28)14(26)15(27)19(33-21)20(29)30/h1-6,14-16,19,21-24,26-28H,(H,29,30)/t14-,15+,16+,19+,21-/m1/s1 |
| SMILES |
O=C(O)[C@H]1O[C@@H](Oc2c(-c3ccc(O)cc3)oc3cc(O)cc(O)c3c2=O)C(O)C(O)[C@@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Apiaceae | Anethum graveolens  | Ref. |
| Plantae | Apiaceae | Anethum sowa  | Ref. |
| Plantae | Apiaceae | Foeniculum vulgare  | Ref. |
| Plantae | Apiaceae | Orlaya daucorlaya | Ref. |
| Plantae | Apiaceae | Orlaya grandiflora | Ref. |
| Plantae | Asteraceae | Arnica montana cv.ARBO  | Ref. |
| Plantae | Asteraceae | Scolymus hispanicus  | Ref. |
| Plantae | Asteraceae | Stephanodoria tomentella | Ref. |
| Plantae | Ebenaceae | Diospyros rhombifolia | Ref. |
| Plantae | Euphorbiaceae | Euphorbia spp. | Ref. |
| Plantae | Fabaceae | Phaseolus vulgaris  | Ref. |
| Plantae | Fabaceae | Vigna radiata  | Ref. |
| Plantae | Labiatae | Perilla frutescens  | Ref. |
| Plantae | Philydraceae | Philydrum lanuginosum | Ref. |
| Plantae | Pteridaceae | Adiantum capillus-veneris  | Ref. |
| Plantae | Pteridaceae | Adiantum cuneatum | Ref. |
| Plantae | Ranunculaceae | Anemone alpina | Ref. |
| Plantae | Zingiberaceae | Etlingera elatior  | Ref. |
| Plantae | Zingiberaceae | Roscoea cauteloides | Ref. |
| Plantae | Zingiberaceae | Roscoea humeana | Ref. |
|
|
zoom in
| Organism | Adiantum cuneatum | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 297.Flavonol O-glycosides
Muller,Planta Med.,18,(1970),114
Bohm,Phytochem.,14,(1975),315 |
|---|
|