| Name |
3,7,4'-Tri-O-methylkaempferol Kaempferol 3,7,4'-trimethyl ether 5-Hydroxy-3,7,4'-trimethoxyflavone 5-Hydroxy-3,7-dimethoxy-2-(4-methoxyphenyl)-4H-1-benzopyran-4-one |
| Formula |
C18H16O6 |
| Mw |
328.09468824 |
| CAS RN |
15486-34-7 |
| C_ID |
C00004573
, 
|
| InChIKey |
WSQWAMGRHJQANC-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C18H16O6/c1-21-11-6-4-10(5-7-11)17-18(23-3)16(20)15-13(19)8-12(22-2)9-14(15)24-17/h4-9,19H,1-3H3 |
| SMILES |
COc1ccc(-c2oc3cc(OC)cc(O)c3c(=O)c2OC)cc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Artemisia campestris  | Ref. |
| Plantae | Asteraceae | Artemisia rupestris | Ref. |
| Plantae | Asteraceae | Baccharis pilularis | Ref. |
| Plantae | Asteraceae | Grindelia nana | Ref. |
| Plantae | Asteraceae | Grindelia tenella | Ref. |
| Plantae | Asteraceae | Haplopappus hirtellus | Ref. |
| Plantae | Asteraceae | Haplopappus sonorensis | Ref. |
| Plantae | Asteraceae | Ozothamnus scutellifolius | Ref. |
| Plantae | Asteraceae | Senecio viscosus | Ref. |
| Plantae | Asteraceae | Stevia subpubescens | Ref. |
| Plantae | Asteraceae | Xanthocephalum gymnospermoides | Ref. |
| Plantae | Betulaceae | Betula nigra  | Ref. |
| Plantae | Boraginaceae | Heliotropium pycnophyllum | Ref. |
| Plantae | Calceolariaceae | Calceolaria chelidonioides | Ref. |
| Plantae | Capparaceae | Cleome spinosa  | Ref. |
| Plantae | Cistaceae | Cistus spp. | Ref. |
| Plantae | Crassulaceae | Aeonium goochiae | Ref. |
| Plantae | Crassulaceae | Aeonium lindleyi | Ref. |
| Plantae | Cunoniaceae | Eucryphia lucida | Ref. |
| Plantae | Cunoniaceae | Eucryphia milliganii | Ref. |
| Plantae | Labiatae | Dorystoechas hastata | Ref. |
| Plantae | Labiatae | Sideritis kuegleriana | Ref. |
| Plantae | Labiatae | Sideritis lotsyi | Ref. |
| Plantae | Lauraceae | Aniba spp. | Ref. |
| Plantae | Nothofagaceae/Fagaceae | Nothofagus cunninghamii | Ref. |
| Plantae | Nyctaginaceae | Mirabilis viscosa | Ref. |
| Plantae | Piperaceae | Piper philippinum | Ref. |
| Plantae | Plantaginaceae | Digitalis viridiflora | Ref. |
| Plantae | Pteridaceae | Cheilanthes farinosa  | Ref. |
| Plantae | Pteridaceae | Cheilanthes grisea | Ref. |
| Plantae | Sapindaceae | Dodonaea viscosa  | Ref. |
| Plantae | Solanaceae | Solanum pubescens | Ref. |
| Plantae | Taxodiaceae | Cryptomeria japonica | Ref. |
| Plantae | Zingiberaceae | Aframomum giganteum | Ref. |
| Plantae | Zingiberaceae | Alpinia flabellata | Ref. |
| Plantae | Zingiberaceae | Amomum koenigii | Ref. |
| Plantae | Zingiberaceae | Hedychium coronarium  | Ref. |
| Plantae | Zingiberaceae | Kaempferia parviflora  | Ref. |
| Plantae | Zingiberaceae | Zingiber officinale  | Ref. |
| - | - | Currania robertiana | Ref. |
| - | - | Reneilmia cincinnata | Ref. |
| - | - | Sparuna apiosyce | Ref. |
|
|
zoom in
| Organism | Cistus spp. | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 181.Flavonols
Erdtman,Tetrahedron (Suppl.7),8,(1966),71 |
|---|
|