| Name |
Oroxylin A |
| Formula |
C16H12O5 |
| Mw |
284.06847349 |
| CAS RN |
480-11-5 |
| C_ID |
C00003804
, 
|
| InChIKey |
LKOJGSWUMISDOF-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C16H12O5/c1-20-16-11(18)8-13-14(15(16)19)10(17)7-12(21-13)9-5-3-2-4-6-9/h2-8,18-19H,1H3 |
| SMILES |
COc1c(O)cc2oc(-c3ccccc3)cc(=O)c2c1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Acanthaceae | Rhinacanthus nasutus | Ref. |
| Plantae | Amaranthaceae | Gomphrena boliviana | Ref. |
| Plantae | Amaranthaceae | Gomphrena martiana | Ref. |
| Plantae | Apiaceae | Bupleurum scorzonerifolium  | Ref. |
| Plantae | Asteraceae | Carthamus glauca | Ref. |
| Plantae | Asteraceae | Flourensia laurifolia | Ref. |
| Plantae | Bignoniaceae | Oroxylum indicum  | Ref. |
| Plantae | Bignoniaceae | Pajanelia multijuga | Ref. |
| Plantae | Capparaceae | Capparis himalayensis | Ref. |
| Plantae | Labiatae | Scutellaria amoena | Ref. |
| Plantae | Labiatae | Scutellaria baicalensis GEORGI  | Ref. |
| Plantae | Labiatae | Scutellaria hypericifolia | Ref. |
| Plantae | Labiatae | Scutellaria likiangensis | Ref. |
| Plantae | Labiatae | Scutellaria rehderiana | Ref. |
| Plantae | Labiatae | Scutellaria seleriana | Ref. |
| Plantae | Labiatae | Scutellaria viscidula | Ref. |
| Plantae | Rosaceae | Adenostoma sparsifolium | Ref. |
|
|
zoom in
| Organism | Scutellaria viscidula | | Reference | Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979).
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Buckingham(Executive Editor), Dictionary of Natural Products, Chapman & Hall, 1994, Vol1-7
1995, Vol8
1996, Vol9
1997, Vol10
1998, Vol11.
Chang, et al., Phytochemistry, 64, (2003), 1375.
Calixto, et al., Planta Med, 69, (2003), 973.
Chen, Liu, et al., Determination of Effective Components in Traditional Chinese medicines, People's Medical Publishing House, Beijing, (2009) |
|---|
|