| Name |
(-)-Falcarinol Falcarinol Panaxynol |
| Formula |
C17H24O |
| Mw |
244.18271539 |
| CAS RN |
21852-80-2 |
| C_ID |
C00001284
, 
|
| InChIKey |
UGJAEDFOKNAMQD-AGDOHHJYNA-N |
| InChICode |
InChI=1S/C17H24O/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17(18)4-2/h4,10-11,17-18H,2-3,5-9,12H2,1H3/b11-10+/t17-/m1/s1 |
| SMILES |
C=C[C@@H](O)C#CC#CC/C=C/CCCCCCC |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Apiaceae | Angelica furcijuga KITAGAWA | Ref. |
| Plantae | Apiaceae | Apium graveolens  | Ref. |
| Plantae | Apiaceae | Crithmum maritimum  | Ref. |
| Plantae | Apiaceae | Daucus carot | Ref. |
| Plantae | Apiaceae | Daucus carota L.  | Ref. |
| Plantae | Apiaceae | Falcaria vulgaris | Ref. |
| Plantae | Apiaceae | Foeniculum vulgare  | Ref. |
| Plantae | Apiaceae | Niphogeton ternata | Ref. |
| Plantae | Apiaceae | Oenanthe crocata  | Ref. |
| Plantae | Apiaceae | Oenanthe javanica  | Ref. |
| Plantae | Apiaceae | Pastinaca satica | Ref. |
| Plantae | Araliaceae | Hedera canariensis | Ref. |
| Plantae | Araliaceae | Hedera helix  | Ref. |
| Plantae | Araliaceae | Panax ginseng  | Ref. |
| Plantae | Araliaceae | Panax notoginseng  | Ref. |
| Plantae | Araliaceae | Panax pseudo-ginseng var.notoginseng  | Ref. |
| Plantae | Araliaceae | Panax quinquefolium  | Ref. |
| Plantae | Araliaceae | Panax vietnamensis | Ref. |
| Plantae | Araliaceae | Schefflera arboricola  | Ref. |
| Plantae | Solanaceae | Solanum lycopersicum  | Ref. |
|
|
zoom in
| Organism | Panax pseudo-ginseng var.notoginseng | | Reference | Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Sun, et al., CTHD, 33, (2002), 490.
Yoshikawa, et al., JNP, 66, (2003), 922 |
|---|
|