| Name |
Thiamine Thiamin Vitamin B1 |
| Formula |
C12H17N4OS |
| Mw |
265.11230692 |
| CAS RN |
59-43-8 |
| C_ID |
C00000775
, 
|
| InChIKey |
JZRWCGZRTZMZEH-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C12H17N4OS/c1-8-11(3-4-17)18-7-16(8)6-10-5-14-9(2)15-12(10)13/h5,7,17H,3-4,6H2,1-2H3,(H2,13,14,15)/q+1 |
| SMILES |
Cc1ncc(C[n+]2csc(CCO)c2C)c(N)n1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Tyr L-Phe |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Bacteria | Enterobacteriaceae | Escherichia coli | Ref. |
| Fungi | Clavicipitaceae | Cordyceps sinensis  | Ref. |
| Plantae | Amaranthaceae | Celosia cristada | Ref. |
| Plantae | Anacardiaceae | Mangifera indica  | Ref. |
| Plantae | Araliaceae | Panax ginseng  | Ref. |
| Plantae | Asparagaceae | Asparagus officinalis  | Ref. |
| Plantae | Cruciferae | Brassica oleracea  | Ref. |
| Plantae | Elaeagnaceae | Hippophae rhamnoides  | Ref. |
| Plantae | Fabaceae | Medicago sativa  | Ref. |
| Plantae | Fabaceae | Phaseolus vulgaris  | Ref. |
| Plantae | Fabaceae | Trigonella foenum-graecum  | Ref. |
| Plantae | Labiatae | Perilla frutescens var.arguta  | Ref. |
| Plantae | Moraceae | Morus alba  | Ref. |
| Plantae | Myrtaceae | Syzygium cumini  | Ref. |
| Plantae | Poaceae | Phragmites communis  | Ref. |
| Plantae | Rhamnaceae | Ziziphus jujuba  | Ref. |
| Plantae | Solanaceae | Lycium chinense  | Ref. |
| - | - | | Ref. |
| - | - | FOOD SAKE | Ref. |
|
|
zoom in
| Organism | Ziziphus jujuba | | Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Wang, et al., Handbook of Effective Components in Vegetal Medicines, People Health Press, Beijing, (1986).
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Buckingham(Executive Editor), Dictionary of Natural Products, Chapman & Hall, 1994, Vol1-7
1995, Vol8
1996, Vol9
1997, Vol10
1998, Vol11.
Chen, Liu, et al., Determination of Effective Components in Traditional Chinese medicines, People's Medical Publishing House, Beijing, (2009) |
|---|
|