| Name |
Lupanine (+)-Lupanine |
| Formula |
C15H24N2O |
| Mw |
248.1888634 |
| CAS RN |
550-90-3 |
| C_ID |
C00002225
, 
|
| InChIKey |
JYIJIIVLEOETIQ-WDOYOSBINA-N |
| InChICode |
InChI=1S/C15H24N2O/c18-15-6-3-5-14-11-8-12(10-17(14)15)13-4-1-2-7-16(13)9-11/h11-14H,1-10H2/t11-,12?,13+,14-/m1/s1 |
| SMILES |
O=C1CCC[C@@H]2[C@H]3C[C@@H](CN12)[C@@H]1CCCCN1C3 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Berberidaceae | Caulophyllum thalictroides L. Michx.  | Ref. |
| Plantae | Berberidaceae | Leontice ewersmannii | Ref. |
| Plantae | Berberidaceae | Leontice robustum | Ref. |
| Plantae | Euphorbiaceae | Euphorbia larica | Ref. |
| Plantae | Fabaceae | Ammodendron longiracemosum | Ref. |
| Plantae | Fabaceae | Argyrolobium frutescens | Ref. |
| Plantae | Fabaceae | Argyrolobium lanceolatum | Ref. |
| Plantae | Fabaceae | Argyrolobium lunare | Ref. |
| Plantae | Fabaceae | Argyrolobium molle | Ref. |
| Plantae | Fabaceae | Argyrolobium rupestre | Ref. |
| Plantae | Fabaceae | Argyrolobium sankeyi | Ref. |
| Plantae | Fabaceae | Argyrolobium speciosum | Ref. |
| Plantae | Fabaceae | Argyrolobium tomentosum | Ref. |
| Plantae | Fabaceae | Argyrolobium velutinum | Ref. |
| Plantae | Fabaceae | Aspalathus capitata | Ref. |
| Plantae | Fabaceae | Aspalathus chortophila | Ref. |
| Plantae | Fabaceae | Aspalathus cordata | Ref. |
| Plantae | Fabaceae | Aspalathus hirta | Ref. |
| Plantae | Fabaceae | Aspalathus juniperina | Ref. |
| Plantae | Fabaceae | Aspalathus longifolia | Ref. |
| Plantae | Fabaceae | Aspalathus nivea | Ref. |
| Plantae | Fabaceae | Aspalathus perfoliata | Ref. |
| Plantae | Fabaceae | Baptisia alba | Ref. |
| Plantae | Fabaceae | Baptisia simplicifolia | Ref. |
| Plantae | Fabaceae | Clathrotropis brachypetala  | Ref. |
| Plantae | Fabaceae | Cytisophyllum sessilifolium | Ref. |
| Plantae | Fabaceae | Cytisus albus | Ref. |
| Plantae | Fabaceae | Cytisus baeticus | Ref. |
| Plantae | Fabaceae | Cytisus commutatus | Ref. |
| Plantae | Fabaceae | Cytisus eriocarpus | Ref. |
| Plantae | Fabaceae | Cytisus hirsutus | Ref. |
| Plantae | Fabaceae | Cytisus jankae | Ref. |
| Plantae | Fabaceae | Cytisus lasiosemius | Ref. |
| Plantae | Fabaceae | Cytisus multiflorus  | Ref. |
| Plantae | Fabaceae | Cytisus reverchonii | Ref. |
| Plantae | Fabaceae | Cytisus scoparius  | Ref. |
| Plantae | Fabaceae | Dichilus gracilis | Ref. |
| Plantae | Fabaceae | Dichilus lebeckioides | Ref. |
| Plantae | Fabaceae | Dichilus pilosus | Ref. |
| Plantae | Fabaceae | Dichilus reflexus | Ref. |
| Plantae | Fabaceae | Dichilus strictus | Ref. |
| Plantae | Fabaceae | Diplotropis martiusii | Ref. |
| Plantae | Fabaceae | Echinospartum horridum | Ref. |
| Plantae | Fabaceae | Echinospartum lusitanicum | Ref. |
| Plantae | Fabaceae | Genista albida | Ref. |
| Plantae | Fabaceae | Genista anatolica | Ref. |
| Plantae | Fabaceae | Genista aucheri | Ref. |
| Plantae | Fabaceae | Genista burdurensis | Ref. |
| Plantae | Fabaceae | Genista cinerea | Ref. |
| Plantae | Fabaceae | Genista corsica | Ref. |
| Plantae | Fabaceae | Genista ephedroides | Ref. |
| Plantae | Fabaceae | Genista germanica | Ref. |
| Plantae | Fabaceae | Genista hispanica | Ref. |
| Plantae | Fabaceae | Genista involucrata | Ref. |
| Plantae | Fabaceae | Genista libanotica | Ref. |
| Plantae | Fabaceae | Genista osmariensis | Ref. |
| Plantae | Fabaceae | Genista radiata | Ref. |
| Plantae | Fabaceae | Genista sylvestris | Ref. |
| Plantae | Fabaceae | Genista tejedensis | Ref. |
| Plantae | Fabaceae | Genista triacanthos | Ref. |
| Plantae | Fabaceae | Genista valentina | Ref. |
| Plantae | Fabaceae | Gonocytisus angulatus | Ref. |
| Plantae | Fabaceae | Haplormosia monophylla | Ref. |
| Plantae | Fabaceae | Laburnum alpinum | Ref. |
| Plantae | Fabaceae | Laburnum x watereri | Ref. |
| Plantae | Fabaceae | Lebeckia bowieana | Ref. |
| Plantae | Fabaceae | Lebeckia leipoldtiana | Ref. |
| Plantae | Fabaceae | Lebeckia lotononoides | Ref. |
| Plantae | Fabaceae | Lebeckia macrantha | Ref. |
| Plantae | Fabaceae | Lebeckia melilotoides | Ref. |
| Plantae | Fabaceae | Lebeckia plukenetiana | Ref. |
| Plantae | Fabaceae | Lebeckia pungens | Ref. |
| Plantae | Fabaceae | Lebeckia sericea | Ref. |
| Plantae | Fabaceae | Lebeckia sessilifolia | Ref. |
| Plantae | Fabaceae | Lebeckia simsiana | Ref. |
| Plantae | Fabaceae | Lebeckia spinescens | Ref. |
| Plantae | Fabaceae | Liparia parva | Ref. |
| Plantae | Fabaceae | Liparia splendens | Ref. |
| Plantae | Fabaceae | Lotononis adpressa | Ref. |
| Plantae | Fabaceae | Lotononis bainesii | Ref. |
| Plantae | Fabaceae | Lotononis calycina | Ref. |
| Plantae | Fabaceae | Lotononis carinata | Ref. |
| Plantae | Fabaceae | Lotononis curvicarpa | Ref. |
| Plantae | Fabaceae | Lotononis eriantha | Ref. |
| Plantae | Fabaceae | Lotononis lanceolata | Ref. |
| Plantae | Fabaceae | Lotononis listii | Ref. |
| Plantae | Fabaceae | Lotononis mucronata | Ref. |
| Plantae | Fabaceae | Lotononis platycarpa | Ref. |
| Plantae | Fabaceae | Lotononis wilmsii | Ref. |
| Plantae | Fabaceae | Lotus aegeus | Ref. |
| Plantae | Fabaceae | Lupinus albus  | Ref. |
| Plantae | Fabaceae | Lupinus angustifolius  | Ref. |
| Plantae | Fabaceae | Lupinus arboreus | Ref. |
| Plantae | Fabaceae | Lupinus argenteus var.stenophyllus. | Ref. |
| Plantae | Fabaceae | Lupinus graecus | Ref. |
| Plantae | Fabaceae | Lupinus hirsutus  | Ref. |
| Plantae | Fabaceae | Lupinus latifolius | Ref. |
| Plantae | Fabaceae | Lupinus laxus | Ref. |
| Plantae | Fabaceae | Lupinus luteus  | Ref. |
| Plantae | Fabaceae | Lupinus mutabilis | Ref. |
| Plantae | Fabaceae | Lupinus paniculatus | Ref. |
| Plantae | Fabaceae | Lupinus polyphyllus Lindl. | Ref. |
| Plantae | Fabaceae | Lupinus pubescens | Ref. |
| Plantae | Fabaceae | Lupinus sericeus | Ref. |
| Plantae | Fabaceae | Lupinus spp. | Ref. |
| Plantae | Fabaceae | Lupinus termis | Ref. |
| Plantae | Fabaceae | Lupinus texensis | Ref. |
| Plantae | Fabaceae | Maackia amurensis  | Ref. |
| Plantae | Fabaceae | Melolobium aethiopicum | Ref. |
| Plantae | Fabaceae | Melolobium burchellii | Ref. |
| Plantae | Fabaceae | Melolobium candicans | Ref. |
| Plantae | Fabaceae | Melolobium exudans | Ref. |
| Plantae | Fabaceae | Melolobium stipulatum | Ref. |
| Plantae | Fabaceae | Melolobium wilmsii | Ref. |
| Plantae | Fabaceae | Ormosia coccinea | Ref. |
| Plantae | Fabaceae | Ormosia krugii | Ref. |
| Plantae | Fabaceae | Pearsonia aristata | Ref. |
| Plantae | Fabaceae | Pearsonia cajanifolia | Ref. |
| Plantae | Fabaceae | Pearsonia obovata | Ref. |
| Plantae | Fabaceae | Pearsonia sessilifolia | Ref. |
| Plantae | Fabaceae | Petteria ramentacea | Ref. |
| Plantae | Fabaceae | Piptanthus nepalensis | Ref. |
| Plantae | Fabaceae | Podalyria buxifolia | Ref. |
| Plantae | Fabaceae | Podalyria sericea | Ref. |
| Plantae | Fabaceae | Polhillia brevicalyx | Ref. |
| Plantae | Fabaceae | Polhillia canescens | Ref. |
| Plantae | Fabaceae | Polhillia waltersii | Ref. |
| Plantae | Fabaceae | Rafnia angulata | Ref. |
| Plantae | Fabaceae | Rafnia elliptica | Ref. |
| Plantae | Fabaceae | Rafnia opposita | Ref. |
| Plantae | Fabaceae | Rafnia perfoliata | Ref. |
| Plantae | Fabaceae | Rafnia racemosa | Ref. |
| Plantae | Fabaceae | Retama sphaerocarpa  | Ref. |
| Plantae | Fabaceae | Rothia hirsuta | Ref. |
| Plantae | Fabaceae | Sophora chrysophylla | Ref. |
| Plantae | Fabaceae | Sophora flavescens  | Ref. |
| Plantae | Fabaceae | Sophora mollis  | Ref. |
| Plantae | Fabaceae | Sophora secundiflora  | Ref. |
| Plantae | Fabaceae | Sophora viciifolia | Ref. |
| Plantae | Fabaceae | Spartidium saharae | Ref. |
| Plantae | Fabaceae | Spartium junceum  | Ref. |
| Plantae | Fabaceae | Templetonia egena | Ref. |
| Plantae | Fabaceae | Thermopsis chinensis | Ref. |
| Plantae | Fabaceae | Thermopsis lanceolata | Ref. |
| Plantae | Fabaceae | Thermopsis lupinoides | Ref. |
| Plantae | Fabaceae | Ulex airensis | Ref. |
| Plantae | Fabaceae | Ulex australis | Ref. |
| Plantae | Fabaceae | Ulex densus | Ref. |
| Plantae | Fabaceae | Ulex europaeus  | Ref. |
| Plantae | Fabaceae | Ulex jussiaei | Ref. |
| Plantae | Fabaceae | Ulex minor | Ref. |
| Plantae | Fabaceae | Wiborgia fusca | Ref. |
| Plantae | Fabaceae | Wiborgia obcordata | Ref. |
| Plantae | Fabaceae | Wiborgia sericea | Ref. |
| - | - | Camaecytisus absinthioides | Ref. |
|
|
zoom in
| Organism | Thermopsis lanceolata | | Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979).
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998) |
|---|
|