| Name |
Valencene |
| Formula |
C15H24 |
| Mw |
204.18780077 |
| CAS RN |
4630-07-3 |
| C_ID |
C00034741
, 
|
| InChIKey |
QEBNYNLSCGVZOH-ZECJTJDJNA-N |
| InChICode |
InChI=1S/C15H24/c1-11(2)13-8-9-14-7-5-6-12(3)15(14,4)10-13/h7,12-13H,1,5-6,8-10H2,2-4H3/t12-,13-,15+/m1/s1 |
| SMILES |
C=C(C)[C@@H]1CCC2=CCC[C@@H](C)[C@]2(C)C1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Anacardiaceae | Mangifera indica  | Ref. |
| Plantae | Apiaceae | Apium graveolens  | Ref. |
| Plantae | Apiaceae | Daucus carota  | Ref. |
| Plantae | Cannabaceae | Humulus lupulus  | Ref. |
| Plantae | Cyperaceae | Cyperus rotundus  | Ref. |
| Plantae | Gymnomitriaceae | Marsupella emarginata | Ref. |
| Plantae | Jubulaceae | Frullania pycnantha | Ref. |
| Plantae | Labiatae | Perilla frutescens  | Ref. |
| Plantae | Labiatae | Pogostemon cablin  | Ref. |
| Plantae | Labiatae | Rosmarinus officinalis  | Ref. |
| Plantae | Labiatae | Satureja subspicata  | Ref. |
| Plantae | Myrtaceae | Psidium guajava  | Ref. |
| Plantae | Polygonaceae | Polygonum minus | Ref. |
| Plantae | Porellaceae | Porella acutifolia ssp.tosana | Ref. |
| Plantae | Primulaceae | Primula halleri | Ref. |
| Plantae | Rutaceae | Citrus limon  | Ref. |
| Plantae | Rutaceae | Citrus reticulata  | Ref. |
| Plantae | Rutaceae | Citrus sinensis L.  | Ref. |
| Plantae | Solanaceae | Nicotiana tabacum  | Ref. |
| Plantae | Valerianaceae | Nardostachys jatamansi  | Ref. |
| Plantae | Valerianaceae/Linnaeaceae/Dipsacaceae/Diervillaceae | Valeriana officinalis  | Ref. |
| Plantae | Zingiberaceae | Zingiber officinale  | Ref. |
|
|
zoom in
| Organism | Primula halleri | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|