| Name |
Martynoside |
| Formula |
C31H40O15 |
| Mw |
652.23672061 |
| CAS RN |
67884-12-2 |
| C_ID |
C00034597
, 
|
| InChIKey |
WLWAYPFRKDSFCL-HCRRKUBANA-N |
| InChICode |
InChI=1S/C31H40O15/c1-15-24(36)25(37)26(38)31(43-15)46-29-27(39)30(42-11-10-17-5-8-20(40-2)19(34)12-17)44-22(14-32)28(29)45-23(35)9-6-16-4-7-18(33)21(13-16)41-3/h4-9,12-13,15,22,24-34,36-39H,10-11,14H2,1-3H3/b9-6+/t15-,22+,24-,25+,26+,27+,28+,29+,30+,31-/m0/s1 |
| SMILES |
COc1ccc(CCO[C@@H]2O[C@H](CO)[C@@H](OC(=O)/C=C/c3ccc(O)c(OC)c3)[C@H](O[C@@H]3O[C@@H](C)[C@H](O)[C@@H](O)[C@H]3O)[C@H]2O)cc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Acanthaceae | Acanthus ebracteatus | Ref. |
| Plantae | Acanthaceae | Strobilanthes cusia  | Ref. |
| Plantae | Bignoniaceae | Fernandoa adenophylla | Ref. |
| Plantae | Labiatae | Leucosceptrum japonicum | Ref. |
| Plantae | Labiatae | Prostanthera melissifolia | Ref. |
| Plantae | Labiatae | Salvia officinalis  | Ref. |
| Plantae | Labiatae | Schnabelia tetradonta | Ref. |
| Plantae | Labiatae | Scutellaria albida subsp.albida | Ref. |
| Plantae | Labiatae | Scutellaria baicalensis  | Ref. |
| Plantae | Labiatae | Stachys lanata | Ref. |
| Plantae | Malvaceae | Firmiana platanifolia | Ref. |
| Plantae | Orobanchaceae | Pedicularis longiflora var. tubiformis | Ref. |
| Plantae | Orobanchaceae | Pedicularis muscicola | Ref. |
| Plantae | Orobanchaceae | Pedicularis nordmanniana | Ref. |
| Plantae | Paulowniaceae | Paulownia tomentosa | Ref. |
| Plantae | Plantaginaceae | Bacopa monniera | Ref. |
| Plantae | Plantaginaceae | Plantago lanceolata  | Ref. |
| Plantae | Plantaginaceae | Veronica anagallis-aquatica  | Ref. |
| Plantae | Scrophulariaceae | Rehmannia glutinosa  | Ref. |
| Plantae | Scrophulariaceae | Scrophularia dentata | Ref. |
| Plantae | Scrophulariaceae | Verbascum wiedemannianum | Ref. |
| - | - | Pentemon gentianoides HBK | Ref. |
|
|
zoom in
| Organism | Paulownia tomentosa | | Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Sahin, et al., Phytochemistry, 65, (2004), 2095.
Hou, et al., Journal of Natural Products, 65, (2002), 1759.
Dou, et al., Journal of Natural Products, 65, (2002), 1777.
Budzianowska, et al., Planta Med, 70, (2004), 834.
Abougazar, et al., Planta Med, 69, (2003), 814 |
|---|
|