| Name |
Oxypeucedanin hydrate Aviprin (+)-Aviprin (+)-Oxypeucedanin hydrate |
| Formula |
C16H16O6 |
| Mw |
304.09468824 |
| CAS RN |
2643-85-8 |
| C_ID |
C00030905
, 
|
| InChIKey |
PEWFWDOPJISUOK-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C16H16O6/c1-16(2,19)13(17)8-21-15-9-3-4-14(18)22-12(9)7-11-10(15)5-6-20-11/h3-7,13,17,19H,8H2,1-2H3/t13-/m1/s1 |
| SMILES |
CC(C)(O)C(O)COc1c2ccoc2cc2oc(=O)ccc12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Apiaceae | Angelica dahurica var.dahurica  | Ref. |
| Plantae | Apiaceae | Angelica furcijuga | Ref. |
| Plantae | Apiaceae | Ferula sumbul  | Ref. |
| Plantae | Apiaceae | Ferula syreitschikowii | Ref. |
| Plantae | Apiaceae | Niphogeton ternata | Ref. |
| Plantae | Apiaceae | Ostericum koreanum | Ref. |
| Plantae | Apiaceae | Peucedanum ostruthium  | Ref. |
| Plantae | Apiaceae | Peucedanum tauricum | Ref. |
| Plantae | Apiaceae | Peucedanum turcomanicum | Ref. |
| Plantae | Apiaceae | Prangos bucharica | Ref. |
| Plantae | Apiaceae | Prangos latiloba | Ref. |
| Plantae | Apiaceae | Prangos pabularia  | Ref. |
| Plantae | Apiaceae | Seseli webbii Cosson. | Ref. |
| Plantae | Rutaceae | Citrus limon  | Ref. |
| - | - | Sphallerocarpus gracilis | Ref. |
|
|
zoom in
| Organism | Sphallerocarpus gracilis | | Reference | MATSUDA, et al., Chem Pharm Bull, 53, (2005), 387.
Shao, et al., Natural Product Research and Development(Tianran Chanwu Yanjiu Yu Kaifa), 15, (2003), 196.
Chen, et al., Lexicon of Active Componentsin in Plants, Vol1, Medicinal Science and Technology Press of China, Beijing, (2001).
Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993). |
|---|
|