| Name |
(+)-Corytuberine Corytuberine |
| Formula |
C19H21NO4 |
| Mw |
327.14705817 |
| CAS RN |
517-56-6 |
| C_ID |
C00025655
, 
|
| InChIKey |
WHFUDAOCYRYAKQ-STGVRZAANA-N |
| InChICode |
InChI=1S/C19H21NO4/c1-20-7-6-11-9-14(24-3)19(22)17-15(11)12(20)8-10-4-5-13(23-2)18(21)16(10)17/h4-5,9,12,21-22H,6-8H2,1-3H3/t12-/m0/s1 |
| SMILES |
COc1ccc2c(c1O)-c1c(O)c(OC)cc3c1[C@H](C2)N(C)CC3 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Annonaceae | Annona montana  | Ref. |
| Plantae | Annonaceae | Guatteria goudotiana | Ref. |
| Plantae | Annonaceae | Monodora junodii | Ref. |
| Plantae | Annonaceae | Oncodostigma monosperma | Ref. |
| Plantae | Annonaceae | Xylopia parviflora  | Ref. |
| Plantae | Annonaceae | Xylopia vieillardi | Ref. |
| Plantae | Aristolochiaceae | Aristolochia gigantea | Ref. |
| Plantae | Berberidaceae | Caulophyllum thalicroides | Ref. |
| Plantae | Berberidaceae | Podophyllum peltatum  | Ref. |
| Plantae | Fumariaceae | Corydalis dasyptera | Ref. |
| Plantae | Fumariaceae | Corydalis gortschakovii | Ref. |
| Plantae | Fumariaceae | Corydalis nobilis | Ref. |
| Plantae | Fumariaceae | Fumaria densiflora | Ref. |
| Plantae | Fumariaceae | Fumaria officinalis  | Ref. |
| Plantae | Fumariaceae | Fumaria schramii | Ref. |
| Plantae | Hernandiaceae | Hernandia sonora | Ref. |
| Plantae | Lauraceae | Dehaasia triandra | Ref. |
| Plantae | Lauraceae | Litsea deccanensis | Ref. |
| Plantae | Lauraceae | Neolitsea konishii | Ref. |
| Plantae | Lauraceae | Ocotea holdrigeana | Ref. |
| Plantae | Lauraceae | Phoebe minutiflora | Ref. |
| Plantae | Magnoliaceae | Magnolia officinalis  | Ref. |
| Plantae | Menispermaceae | Cissampelos pareira L.  | Ref. |
| Plantae | Menispermaceae | Kolobopetalum auriculatum Engl. | Ref. |
| Plantae | Menispermaceae | Stephania brachyandra Diels | Ref. |
| Plantae | Menispermaceae | Stephania macrantha | Ref. |
| Plantae | Menispermaceae | Stephania micrantha H.S.Lo | Ref. |
| Plantae | Menispermaceae | Stephania officinarum | Ref. |
| Plantae | Menispermaceae | Tinospora cordifolia  | Ref. |
| Plantae | Papaveraceae | Eschscholzia californica  | Ref. |
| Plantae | Papaveraceae | Glaucium fimbrilligerum Boiss. | Ref. |
| Plantae | Papaveraceae | Meconopsis cambrica | Ref. |
| Plantae | Papaveraceae | Meconopsis robusta | Ref. |
| Plantae | Papaveraceae | Papaver albiflorum | Ref. |
| Plantae | Papaveraceae | Papaver confine | Ref. |
| Plantae | Papaveraceae | Papaver dubium | Ref. |
| Plantae | Papaveraceae | Papaver pinnatifidum | Ref. |
| Plantae | Papaveraceae | Papaver rhoeas  | Ref. |
| Plantae | Papaveraceae | Papaver setigerum | Ref. |
| Plantae | Papaveraceae | Papaver somniferum  | Ref. |
| Plantae | Papaveraceae | Papaver stevenianum | Ref. |
| Plantae | Papaveraceae | Papaver tatricum | Ref. |
| Plantae | Papaveraceae | Stylophorum lasiocarpum | Ref. |
| Plantae | Ranunculaceae | Aconitum firmum | Ref. |
| Plantae | Ranunculaceae | Actaea racemosa  | Ref. |
| Plantae | Ranunculaceae | Clematis parviloba | Ref. |
| Plantae | Ranunculaceae | Coptis japonica  | Ref. |
| Plantae | Ranunculaceae | Delphinium pentagynum | Ref. |
| Plantae | Ranunculaceae | Thalictrum flavum | Ref. |
| Plantae | Rhamnaceae | Zizyphus jujuba var. spinosa  | Ref. |
| - | - | Dilphinium caeruleum | Ref. |
|
|
zoom in
| Organism | Fumaria schramii | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|