| Name |
Dihydrochelerythrine 12,13-Dihydrochelerythrine |
| Formula |
C21H19NO4 |
| Mw |
349.1314081 |
| CAS RN |
6880-91-7 |
| C_ID |
C00024641
, 
|
| InChIKey |
ALZAZMCIBRHMFF-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C21H19NO4/c1-22-10-16-13(6-7-17(23-2)21(16)24-3)14-5-4-12-8-18-19(26-11-25-18)9-15(12)20(14)22/h4-9H,10-11H2,1-3H3 |
| SMILES |
COc1ccc2c(c1OC)CN(C)c1c-2ccc2cc3c(cc12)OCO3 |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Tyr |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia lucida  | Ref. |
| Plantae | Fumariaceae | Corydalis ledebouriana | Ref. |
| Plantae | Meliaceae | Xylocarpus granatum  | Ref. |
| Plantae | Papaveraceae | Bocconia integrifolia  | Ref. |
| Plantae | Papaveraceae | Eschscholtzia californica Cham | Ref. |
| Plantae | Papaveraceae | Glaucium bois | Ref. |
| Plantae | Papaveraceae | Glaucium elegans | Ref. |
| Plantae | Papaveraceae | Glaucium flavum Cr.var.vestitum  | Ref. |
| Plantae | Ranunculaceae | Coptis chinensis  | Ref. |
| Plantae | Rutaceae | Fagara angolensis | Ref. |
| Plantae | Rutaceae | Fagara chalybea Engl. | Ref. |
| Plantae | Rutaceae | Fagara holstii | Ref. |
| Plantae | Rutaceae | Toddalia asiatica Lamk.  | Ref. |
| Plantae | Rutaceae | Zanthoxylum coriaceum | Ref. |
| Plantae | Rutaceae | Zanthoxylum spinosum Swingle | Ref. |
| Plantae | Rutaceae | Zanthoxylum tessmannii | Ref. |
|
|
zoom in
| Organism | Zanthoxylum spinosum Swingle | | Reference | Gray,The Chemistry and Biology of Isoquinoline Alkaloids.London,(1984),20 |
|---|
|