| Name |
Kaempferol 3,7-di-O-glucoside Kaempferol 3,7-O-beta-D-diglucopyranoside Kaempferol 3,7-diglucoside Kaempferol-3,7-diglucoside |
| Formula |
C27H30O16 |
| Mw |
610.15338491 |
| CAS RN |
25615-14-9 |
| C_ID |
C00005182
, 
|
| InChIKey |
XFFQVRFGLSBFON-AVNJKGJRNA-N |
| InChICode |
InChI=1S/C27H30O16/c28-7-14-17(32)20(35)22(37)26(41-14)39-11-5-12(31)16-13(6-11)40-24(9-1-3-10(30)4-2-9)25(19(16)34)43-27-23(38)21(36)18(33)15(8-29)42-27/h1-6,14-15,17-18,20-23,26-33,35-38H,7-8H2/t14-,15-,17-,18-,20+,21-,22-,23-,26-,27+/m1/s1 |
| SMILES |
O=c1c(O[C@@H]2OC(CO)[C@@H](O)C(O)C2O)c(-c2ccc(O)cc2)oc2cc(O[C@@H]3OC(CO)[C@@H](O)[C@H](O)C3O)cc(O)c12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Amaryllidaceae | Narcissus poeticus | Ref. |
| Plantae | Aspleniaceae | Asplenium bulbiferum  | Ref. |
| Plantae | Cruciferae | Brassica oleracea  | Ref. |
| Plantae | Cruciferae | Raphanus sativus  | Ref. |
| Plantae | Cruciferae | Sinapis arvensis  | Ref. |
| Plantae | Cruciferae | Sisymbrium spp. | Ref. |
| Plantae | Cucurbitaceae | Marah oreganus | Ref. |
| Plantae | Equisetaceae | Equisetum arvense  | Ref. |
| Plantae | Equisetaceae | Equisetum debile | Ref. |
| Plantae | Equisetaceae | Equisetum hiemale | Ref. |
| Plantae | Equisetaceae | Equisetum palustre | Ref. |
| Plantae | Equisetaceae | Equisetum pratense | Ref. |
| Plantae | Equisetaceae | Equisetum sylvaticum | Ref. |
| Plantae | Equisetaceae | Equisetum telmateja | Ref. |
| Plantae | Fabaceae | Acacia mangium  | Ref. |
| Plantae | Fabaceae | Medicago polymorpha  | Ref. |
| Plantae | Fabaceae | Medicago radiata | Ref. |
| Plantae | Fabaceae | Ononis natrix  | Ref. |
| Plantae | Fabaceae | Trigonella coerulescens | Ref. |
| Plantae | Fabaceae | Trigonella foenum-graecum  | Ref. |
| Plantae | Fabaceae | Vicia faba  | Ref. |
| Plantae | Fabaceae | Vicia sepium  | Ref. |
| Plantae | Moraceae | Cudrania cochinchinensis var. gerontogea  | Ref. |
| Plantae | Moraceae | Morus alba  | Ref. |
| Plantae | Paeoniaceae | Paeonia albiflora  | Ref. |
| Plantae | Pteridaceae | Adiantum capillus-veneris  | Ref. |
| Plantae | Saxifragaceae | Heuchera micrantha | Ref. |
| Plantae | Solanaceae | Petunia x hybrida | Ref. |
| Plantae | Solanaceae | Solanum lycopersicum  | Ref. |
| Plantae | Solanaceae | Solanum spp. | Ref. |
| Plantae | Zygophyllaceae | Tribulus pentandrus | Ref. |
|
|
zoom in
| Organism | Acacia mangium | | Reference | Singh, B and Sharma, R. A., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|