| Name |
Centaureidin 5,7,3'-Trihydroxy-3,6,4'-trimethoxyflavone Desmethoxycentaureidine Quercetagetin 3,4',6-trimethyl ether 5,7-Dihydroxy-2-(3-hydroxy-4-methoxyphenyl)-3,6-dimethoxy-4H-1-benzopyran-4-one |
| Formula |
C18H16O8 |
| Mw |
360.08451749 |
| CAS RN |
17313-52-9 |
| C_ID |
C00004694
, 
|
| InChIKey |
BZXULYMZYPRZOG-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C18H16O8/c1-23-11-5-4-8(6-9(11)19)16-18(25-3)15(22)13-12(26-16)7-10(20)17(24-2)14(13)21/h4-7,19-21H,1-3H3 |
| SMILES |
COc1ccc(-c2oc3cc(O)c(OC)c(O)c3c(=O)c2OC)cc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Achillea atrata | Ref. |
| Plantae | Asteraceae | Achillea clavennae | Ref. |
| Plantae | Asteraceae | Achillea multifida | Ref. |
| Plantae | Asteraceae | Ajania fruticulosa  | Ref. |
| Plantae | Asteraceae | Ambrosia chamissonis | Ref. |
| Plantae | Asteraceae | Anthemis tinctoria  | Ref. |
| Plantae | Asteraceae | Artemisia abrotanum  | Ref. |
| Plantae | Asteraceae | Artemisia barrelieri | Ref. |
| Plantae | Asteraceae | Asteriscus sericeus | Ref. |
| Plantae | Asteraceae | Baccharis salicina | Ref. |
| Plantae | Asteraceae | Baccharis sarothroides | Ref. |
| Plantae | Asteraceae | Bahia xylopoda | Ref. |
| Plantae | Asteraceae | Centaurea bracteata Scop. | Ref. |
| Plantae | Asteraceae | Centaurea jacea | Ref. |
| Plantae | Asteraceae | Chrysanthemum cinerariifolium  | Ref. |
| Plantae | Asteraceae | Eriophyllum confertiflorum | Ref. |
| Plantae | Asteraceae | Eupatorium buniifolium | Ref. |
| Plantae | Asteraceae | Grindelia robusta | Ref. |
| Plantae | Asteraceae | Grindelia tarapacana | Ref. |
| Plantae | Asteraceae | Iva frutescens | Ref. |
| Plantae | Asteraceae | Pluchea sagittalis  | Ref. |
| Plantae | Asteraceae | Polymnia fruticosa | Ref. |
| Plantae | Asteraceae | Stevia berlandieri | Ref. |
| Plantae | Asteraceae | Tanacetum microphyllum | Ref. |
| Plantae | Asteraceae | Tanacetum parthenium  | Ref. |
| Plantae | Betulaceae | Alnus glutinosa  | Ref. |
| Plantae | Crassulaceae | Aeonium spp. | Ref. |
|
|
zoom in
| Organism | Chrysanthemum cinerariifolium | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 181.Flavonols
Farkas,Chem.Ber.,97,(1964),1666 |
|---|
|