| Name |
Ayanin 3,7,4'-Tri-O-methylquercetin 5,3'-Dihydroxy-3,7,4'-trimethoxyflavone 5-Hydroxy-2-(3-hydroxy-4-methoxyphenyl)-3,7-dimethoxy-4H-1-benzopyran-4-one Ayarin |
| Formula |
C18H16O7 |
| Mw |
344.08960287 |
| CAS RN |
572-32-7 |
| C_ID |
C00004647
, 
|
| InChIKey |
KPCRYSMUMBNTCK-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C18H16O7/c1-22-10-7-12(20)15-14(8-10)25-17(18(24-3)16(15)21)9-4-5-13(23-2)11(19)6-9/h4-8,19-20H,1-3H3 |
| SMILES |
COc1cc(O)c2c(=O)c(OC)c(-c3ccc(OC)c(O)c3)oc2c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Ageratina havanensis | Ref. |
| Plantae | Asteraceae | Bahia glandulosa | Ref. |
| Plantae | Asteraceae | Encelia spp. | Ref. |
| Plantae | Asteraceae | Eupatorium triplinerve  | Ref. |
| Plantae | Asteraceae | Grindelia squarrosa | Ref. |
| Plantae | Asteraceae | Gutierrezia alamanii | Ref. |
| Plantae | Asteraceae | Haplopappus chrysanthemifolius | Ref. |
| Plantae | Asteraceae | Haplopappus hirtellus | Ref. |
| Plantae | Asteraceae | Heterotheca inuloides | Ref. |
| Plantae | Asteraceae | Isocoma spp. | Ref. |
| Plantae | Asteraceae | Ozothamnus scutellifolius | Ref. |
| Plantae | Asteraceae | Pterocaulon virgatum  | Ref. |
| Plantae | Asteraceae | Stevia subpubescens | Ref. |
| Plantae | Boraginaceae | Heliotropium chenopodiaceum var. ericoideum | Ref. |
| Plantae | Boraginaceae | Heliotropium filifolium | Ref. |
| Plantae | Boraginaceae | Heliotropium pycnophyllum | Ref. |
| Plantae | Cunoniaceae | Eucryphia lucida | Ref. |
| Plantae | Cunoniaceae | Eucryphia milliganii | Ref. |
| Plantae | Ericaceae | Rhododendron mucronatum | Ref. |
| Plantae | Escalloniaceae | Escallonia spp. | Ref. |
| Plantae | Fabaceae | Distemonanthus benthamianus  | Ref. |
| Plantae | Hydrophyllaceae | Eriodictyon trichocalyx | Ref. |
| Plantae | Labiatae | Hyptis brevipes  | Ref. |
| Plantae | Labiatae | Salvia glutinosa  | Ref. |
| Plantae | Orchidaceae | Dendrobium densiflorum Lindl.ex.Wall. | Ref. |
| Plantae | Rutaceae | Melicope semecarpifolia | Ref. |
| Plantae | Solanaceae | Petunia surfinia | Ref. |
| Plantae | Taxaceae | Taxus chinensis | Ref. |
| Plantae | Verbenaceae | Lantana camara  | Ref. |
| Plantae | Zingiberaceae | Aframomum giganteum | Ref. |
| Plantae | Zingiberaceae | Amomum koenigii | Ref. |
| Plantae | Zingiberaceae | Kaempferia parviflora  | Ref. |
| - | - | Siegesbeckia jorullensis | Ref. |
| - | - | Siegesbeckia orientalis  | Ref. |
|
|
zoom in
| Organism | Heliotropium filifolium | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|