| Name |
Jaceosidin 5,7,4'-Trihydroxy-6,3'-dimethoxyflavone |
| Formula |
C17H14O7 |
| Mw |
330.0739528 |
| CAS RN |
18085-97-7 |
| C_ID |
C00003890
, 
|
| InChIKey |
GLAAQZFBFGEBPS-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C17H14O7/c1-22-13-5-8(3-4-9(13)18)12-6-10(19)15-14(24-12)7-11(20)17(23-2)16(15)21/h3-7,18,20-21H,1-2H3 |
| SMILES |
COc1cc(-c2cc(=O)c3c(O)c(OC)c(O)cc3o2)ccc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Artemisia vestita  | Ref. |
| Plantae | Asteraceae | Baccharis gaudichaudiana DC | Ref. |
| Plantae | Asteraceae | Centaurea arguta | Ref. |
| Plantae | Asteraceae | Centaurea hierapolitana | Ref. |
| Plantae | Asteraceae | Centaurea jacea | Ref. |
| Plantae | Asteraceae | Eupatorium capillifolium | Ref. |
| Plantae | Asteraceae | Helenium alternifolium | Ref. |
| Plantae | Bromeliaceae | Tillandsia utriculata | Ref. |
| Plantae | Chenopodiaceae | Chenopodium ambrosioides  | Ref. |
| Plantae | Labiatae | Mentha pulegium  | Ref. |
| Plantae | Labiatae | Salvia tomentosa | Ref. |
| Plantae | Labiatae | Salvia triloba  | Ref. |
| Plantae | Plantaginaceae | Digitalis lanata  | Ref. |
| Plantae | Plantaginaceae | Digitalis schischkinii | Ref. |
| Plantae | Plantaginaceae | Veronica officinalis  | Ref. |
| Plantae | Plantaginaceae | Veronica orchidea | Ref. |
| Plantae | Plantaginaceae | Veronica teucrium | Ref. |
| Plantae | Rubiaceae | Morinda citrifolia  | Ref. |
| Plantae | Rutaceae | Citrus sudachi  | Ref. |
| Plantae | Zosteraceae | Phyllospadix japonicus | Ref. |
|
|
zoom in
| Organism | Veronica officinalis | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|