| Name |
Acetophenone
methyl phenyl ketone
Hypnone |
| Formula |
C8H8O |
| Mw |
120.05751488 |
| CAS RN |
98-86-2 |
| C_ID |
C00002685
, 
|
| InChIKey |
KWOLFJPFCHCOCG-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C8H8O/c1-7(9)8-5-3-2-4-6-8/h2-6H,1H3 |
| SMILES |
CC(=O)c1ccccc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Animalia | Cyprinidae | Orthodon linalooliferum | Ref. |
| Plantae | Anacardiaceae | Mangifera indica  | Ref. |
| Plantae | Asteraceae | Dittrichia graveolens | Ref. |
| Plantae | Cistaceae | Cistus creticus | Ref. |
| Plantae | Cistaceae | Cistus ladaniferus | Ref. |
| Plantae | Euphorbiaceae | Jatropha multifida | Ref. |
| Plantae | Fabaceae | Medicago sativa | Ref. |
| Plantae | Myrtaceae | Acca sellowiana | Ref. |
| Plantae | Poaceae | Cymbopogon citratus | Ref. |
| Plantae | Primulaceae | Primula obconica | Ref. |
| Plantae | Proteaceae | Stirlingia latifolia | Ref. |
| Plantae | Rosaceae | Prunus salcina Lindl. (Blackamber) | Ref. |
| Plantae | Salicaceae | Populus balsamifera | Ref. |
| Plantae | Solanaceae | Nicotiana tabacum | Ref. |
| Plantae | Taxaceae | Taxus baccata | Ref. |
| Plantae | Urticaceae | Urtica dioica | Ref. |
| Plantae | Zamiaceae | Apis mellifera (Propolis) | Ref. |
|
|
zoom in
| Organism | Taxus baccata |
|---|
| Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|
