| Name |
Heliotrine |
| Formula |
C16H27NO5 |
| Mw |
313.18892298 |
| CAS RN |
303-33-3 |
| C_ID |
C00002090
, 
|
| InChIKey |
LMFKRLGHEKVMNT-NJTCTYIGNA-N |
| InChICode |
InChI=1S/C16H27NO5/c1-10(2)16(20,11(3)21-4)15(19)22-9-12-5-7-17-8-6-13(18)14(12)17/h5,10-11,13-14,18,20H,6-9H2,1-4H3/t11-,13+,14-,16+/m1/s1 |
| SMILES |
CO[C@H](C)[C@](O)(C(=O)OCC1=CCN2CC[C@H](O)[C@@H]12)C(C)C |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Pro L-Lys L-Arg L-Ala |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Boraginaceae | Arnebia decumbens | Ref. |
| Plantae | Boraginaceae | Heliotropium acutiflorum | Ref. |
| Plantae | Boraginaceae | Heliotropium arbainense | Ref. |
| Plantae | Boraginaceae | Heliotropium bacciferum  | Ref. |
| Plantae | Boraginaceae | Heliotropium circinatum | Ref. |
| Plantae | Boraginaceae | Heliotropium curassavicum | Ref. |
| Plantae | Boraginaceae | Heliotropium dasycarpum | Ref. |
| Plantae | Boraginaceae | Heliotropium dissitiflorum | Ref. |
| Plantae | Boraginaceae | Heliotropium eichwaldii | Ref. |
| Plantae | Boraginaceae | Heliotropium europaeum  | Ref. |
| Plantae | Boraginaceae | Heliotropium hirsutissimum | Ref. |
| Plantae | Boraginaceae | Heliotropium indicum  | Ref. |
| Plantae | Boraginaceae | Heliotropium olgae | Ref. |
| Plantae | Boraginaceae | Heliotropium rotundifolium | Ref. |
| Plantae | Boraginaceae | Heliotropium supinum | Ref. |
| Plantae | Boraginaceae | Heliotropium transoxanum | Ref. |
| Plantae | Boraginaceae | Symphytum caucasium | Ref. |
| - | - | Heliotorpium digynum | Ref. |
|
|
zoom in
| Organism | Heliotropium supinum | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|