| Name |
L-Methionine Methionine |
| Formula |
C5H11NO2S |
| Mw |
149.05104933 |
| CAS RN |
63-68-3 |
| C_ID |
C00001379
, 
|
| InChIKey |
FFEARJCKVFRZRR-SGAVLPGINA-N |
| InChICode |
InChI=1S/C5H11NO2S/c1-9-3-2-4(6)5(7)8/h4H,2-3,6H2,1H3,(H,7,8)/t4-/m0/s1 |
| SMILES |
CSCC[C@H](N)C(=O)O |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Pro L-Lys L-Arg L-Ala |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Animalia | Hominidae | Homo sapiens (Serum) | Ref. |
| Animalia | Hominidae | Homo sapiens (Urine) | Ref. |
| Bacteria | Enterobacteriaceae | Escherichia coli | Ref. |
| Plantae | Anacardiaceae | Mangifera indica  | Ref. |
| Plantae | Araceae | Pinellia ternata  | Ref. |
| Plantae | Campanulaceae/Lobeliaceae | Codonopsis pilosula var.modesta  | Ref. |
| Plantae | Campanulaceae/Lobeliaceae | Codonopsis subglobosa | Ref. |
| Plantae | Campanulaceae/Lobeliaceae | Codonopsis tangshen  | Ref. |
| Plantae | Caryophyllales | Beta vulgaris  | Ref. |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Cruciferae | Brassica oleracea  | Ref. |
| Plantae | Fabaceae | Phaseolus vulgaris  | Ref. |
| Plantae | Fabaceae | Pisum sativum  | Ref. |
| Plantae | Fabaceae | Vicia faba  | Ref. |
| Plantae | Ginkgoaceae | Ginkgo biloba  | Ref. |
| Plantae | Labiatae | Perilla frutescens  | Ref. |
| Plantae | Lythraceae | Punica granatum  | Ref. |
| Plantae | Poaceae | Oryza sativa  | Ref. |
| Plantae | Solanaceae | Capsicum annuum  | Ref. |
| Plantae | Solanaceae | Solanum lycopersicum  | Ref. |
| - | - | Caffea sp. | Ref. |
| - | - | FOOD SAKE | Ref. |
|
|
zoom in
| Organism | Ginkgo biloba | | Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Mo, Chinese J of Pharm Analysis, 30, (2010), 145 |
|---|
|