| Name |
Stachyose |
| Formula |
C24H42O21 |
| Mw |
666.22185841 |
| CAS RN |
470-55-3 |
| C_ID |
C00001150
, 
|
| InChIKey |
UQZIYBXSHAGNOE-IHHFRKLFNA-N |
| InChICode |
InChI=1S/C24H42O21/c25-1-6-10(28)14(32)17(35)21(41-6)39-3-8-11(29)15(33)18(36)22(42-8)40-4-9-12(30)16(34)19(37)23(43-9)45-24(5-27)20(38)13(31)7(2-26)44-24/h6-23,25-38H,1-5H2/t6-,7+,8-,9-,10-,11-,12+,13-,14-,15-,16-,17-,18+,19-,20+,21-,22-,23+,24-/m0/s1 |
| SMILES |
OCC1O[C@H](OCC2O[C@H](OCC3O[C@H](O[C@]4(CO)O[C@H](CO)C(O)[C@H]4O)C(O)[C@@H](O)[C@@H]3O)C(O)[C@@H](O)[C@H]2O)C(O)[C@@H](O)[C@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Bacteria | Enterobacteriaceae | Escherichia coli | Ref. |
| Plantae | Fabaceae | Glycine max  | Ref. |
| Plantae | Fabaceae | Lupinus albus  | Ref. |
| Plantae | Fabaceae | Lupinus luteus  | Ref. |
| Plantae | Fabaceae | Phaseolus vulgaris  | Ref. |
| Plantae | Fabaceae | Vicia faba  | Ref. |
| Plantae | Labiatae | Stachys spp. | Ref. |
| Plantae | Labiatae | Stachys tubifer | Ref. |
| Plantae | Labiatae | Stachys tubifera | Ref. |
| Plantae | Oleaceae | Fraxinus ornus  | Ref. |
| Plantae | Oleaceae | Jasminum officinale  | Ref. |
| Plantae | Plantaginaceae | Plantago asiatica  | Ref. |
| Plantae | Rutaceae | Phellodendron amurense  | Ref. |
| Plantae | Scrophulariaceae | Rehmannia glutinosa  | Ref. |
| Plantae | Verbenaceae | Lantana camara  | Ref. |
| - | - | Caffea sp. | Ref. |
| - | - | Ervum lens | Ref. |
| - | - | Soja max | Ref. |
|
|
zoom in
| Organism | Lantana camara | | Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Pan, et al., APS, 27, (1992), 515.
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
|---|
|