| Name |
Isoeugenol |
| Formula |
C10H12O2 |
| Mw |
164.08372963 |
| CAS RN |
97-54-1 |
| C_ID |
C00000620
, 
|
| InChIKey |
BJIOGJUNALELMI-ONEGZZNKSA-N |
| InChICode |
InChI=1S/C10H12O2/c1-3-4-8-5-6-9(11)10(7-8)12-2/h3-7,11H,1-2H3/b4-3+ |
| SMILES |
C/C=C/c1ccc(O)c(OC)c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Annonaceae | Cananga odorata  | Ref. |
| Plantae | Apiaceae | Angelica sinensis  | Ref. |
| Plantae | Apiaceae | Daucus carota  | Ref. |
| Plantae | Araliaceae | Panax quinquefolium  | Ref. |
| Plantae | Asteraceae | Artemisia scoparia  | Ref. |
| Plantae | Cupressaceae | Juniperus scopulorum  | Ref. |
| Plantae | Labiatae | Ocimum basilicum  | Ref. |
| Plantae | Labiatae | Perilla frutescens  | Ref. |
| Plantae | Myristicaceae | Myristica fragrans  | Ref. |
| Plantae | Myrtaceae | Psidium guajava  | Ref. |
| Plantae | Santalaceae | Santalum album  | Ref. |
| Plantae | Solanaceae | Mandragora autumnalis  | Ref. |
| Plantae | Solanaceae | Nicotiana tabacum  | Ref. |
| Plantae | Zingiberaceae | Zingiber officinale  | Ref. |
| - | - | Jackiella javanica | Ref. |
| - | - | Phytolocca esculenta | Ref. |
|
|
zoom in
| Organism | Jackiella javanica | | Reference | Nagashima,Phytochem.,29,(1990),2169
Asakawa,Progress in the Chemistry of Organic Natural Products.Springer-Verlag Wien,vol 65,(1995) |
|---|
|