| Name |
Acteoside Verbascoside Kusaginin |
| Formula |
C29H36O15 |
| Mw |
624.20542048 |
| CAS RN |
61276-17-3 |
| C_ID |
C00002783
, 
|
| InChIKey |
FBSKJMQYURKNSU-OQSHRHNDNA-N |
| InChICode |
InChI=1S/C29H36O15/c1-13-22(36)23(37)24(38)29(41-13)44-27-25(39)28(40-9-8-15-3-6-17(32)19(34)11-15)42-20(12-30)26(27)43-21(35)7-4-14-2-5-16(31)18(33)10-14/h2-7,10-11,13,20,22-34,36-39H,8-9,12H2,1H3/b7-4+/t13-,20+,22-,23-,24+,25+,26+,27+,28+,29-/m0/s1 |
| SMILES |
CC1O[C@@H](O[C@@H]2C(O)[C@H](OCCc3ccc(O)c(O)c3)OC(CO)[C@H]2OC(=O)/C=C/c2ccc(O)c(O)c2)C(O)[C@@H](O)[C@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Acanthaceae | Acanthus ebracteatus | Ref. |
| Plantae | Acanthaceae | Acanthus ilicifolius  | Ref. |
| Plantae | Acanthaceae | Asystasia intrusa | Ref. |
| Plantae | Acanthaceae | Barleria lupulina  | Ref. |
| Plantae | Acanthaceae | Barleria prionitis  | Ref. |
| Plantae | Acanthaceae | Barleria strigosa  | Ref. |
| Plantae | Acanthaceae | Strobilanthes crispus  | Ref. |
| Plantae | Acanthaceae | Strobilanthes cusia BREMEK  | Ref. |
| Plantae | Bignoniaceae | Barnettia kerrii | Ref. |
| Plantae | Bignoniaceae | Dolichandrone serrulata | Ref. |
| Plantae | Bignoniaceae | Fernandoa adenophylla | Ref. |
| Plantae | Bignoniaceae | Kigelia africana  | Ref. |
| Plantae | Bignoniaceae | Markhamia lutea  | Ref. |
| Plantae | Bignoniaceae | Markhamia stipulata  | Ref. |
| Plantae | Bignoniaceae | Newbouldia laevis  | Ref. |
| Plantae | Buddlejaceae | Buddleja cordata | Ref. |
| Plantae | Buddlejaceae | Buddleja globosa  | Ref. |
| Plantae | Buddlejaceae | Buddleja globose | Ref. |
| Plantae | Buddlejaceae | Buddleja officinalis  | Ref. |
| Plantae | Gesneriaceae | Aeschynanthus bracteatus  | Ref. |
| Plantae | Gesneriaceae | Conandron ramoidioides | Ref. |
| Plantae | Gesneriaceae | Lysionotus pauciflorus  | Ref. |
| Plantae | Globulariaceae | Globularia davisiana | Ref. |
| Plantae | Globulariaceae | Globularia trichosantha | Ref. |
| Plantae | Labiatae | Callicarpa formosana  | Ref. |
| Plantae | Labiatae | Clerodendrum inerme  | Ref. |
| Plantae | Labiatae | Lamium garganicum | Ref. |
| Plantae | Labiatae | Lamium purpureum L.  | Ref. |
| Plantae | Labiatae | Leucosceptrum japonicum | Ref. |
| Plantae | Labiatae | Marrubium vulgare  | Ref. |
| Plantae | Labiatae | Phlomis anisodonta | Ref. |
| Plantae | Labiatae | Phlomis bruguieri | Ref. |
| Plantae | Labiatae | Phlomis brunneogaleata | Ref. |
| Plantae | Labiatae | Phlomis caucasica | Ref. |
| Plantae | Labiatae | Phlomis grandiflora var. grandiflora | Ref. |
| Plantae | Labiatae | Phlomis lanceolata | Ref. |
| Plantae | Labiatae | Prostanthera melissifolia | Ref. |
| Plantae | Labiatae | Scutellaria baicalensis  | Ref. |
| Plantae | Labiatae | Stachys lanata | Ref. |
| Plantae | Magnoliaceae | Magnolia officinalis  | Ref. |
| Plantae | Malvaceae | Firmiana platanifolia | Ref. |
| Plantae | Myoporaceae | Myoporum bontioides | Ref. |
| Plantae | Oleaceae | Abeliophyllum distichum Nakai | Ref. |
| Plantae | Oleaceae | Fontanesia fortunei Carr. | Ref. |
| Plantae | Oleaceae | Fontanesia phillyreoides Labill. | Ref. |
| Plantae | Oleaceae | Forsythia japonica Makino | Ref. |
| Plantae | Oleaceae | Forsythia koreana (Rehd.) Nakai | Ref. |
| Plantae | Oleaceae | Forsythia spp. | Ref. |
| Plantae | Oleaceae | Forsythia viridissima Lindl. | Ref. |
| Plantae | Oleaceae | Fraxinus americana | Ref. |
| Plantae | Oleaceae | Fraxinus americana L. | Ref. |
| Plantae | Oleaceae | Fraxinus excelsior L.  | Ref. |
| Plantae | Oleaceae | Fraxinus griffithii C.B.Clarke  | Ref. |
| Plantae | Oleaceae | Fraxinus malacophylla Hemsl. | Ref. |
| Plantae | Oleaceae | Fraxinus ornus L.  | Ref. |
| Plantae | Oleaceae | Fraxinus oxycarba | Ref. |
| Plantae | Oleaceae | Fraxinus oxycarpa Willd. | Ref. |
| Plantae | Oleaceae | Fraxinus uhdei (Wenzig) Lingelsh. | Ref. |
| Plantae | Oleaceae | Jasminum amplexicaule Buch.-Ham. | Ref. |
| Plantae | Oleaceae | Jasminum mesnyi Hance | Ref. |
| Plantae | Oleaceae | Jasminum nudiflorum | Ref. |
| Plantae | Oleaceae | Jasminum polyanthum Franch. | Ref. |
| Plantae | Oleaceae | Ligustrum obtusifolium Sieb.et Zucc.  | Ref. |
| Plantae | Oleaceae | Ligustrum robustum | Ref. |
| Plantae | Oleaceae | Olea europaea L.  | Ref. |
| Plantae | Oleaceae | Osmanthus fragrans (Thunb.) Lour.  | Ref. |
| Plantae | Oleaceae | Osmanthus heterophyllus (G.Don) P.S.Green  | Ref. |
| Plantae | Oleaceae | Syringa reticulata (Blume) Hara | Ref. |
| Plantae | Oleaceae | Syringa vulgaris L.  | Ref. |
| Plantae | Orobanchaceae | Cistanche deserticola  | Ref. |
| Plantae | Orobanchaceae | Cistanche salsa | Ref. |
| Plantae | Orobanchaceae | Orobanche coerulescens  | Ref. |
| Plantae | Orobanchaceae | Orobanche rapum | Ref. |
| Plantae | Orobanchaceae | Pedicularis condensata | Ref. |
| Plantae | Orobanchaceae | Pedicularis muscicola | Ref. |
| Plantae | Orobanchaceae | Pedicularis nordmanniana | Ref. |
| Plantae | Orobanchaceae | Pedicularis resupinata oppositifolia | Ref. |
| Plantae | Orobanchaceae | Pedicularis sibthorpii | Ref. |
| Plantae | Orobanchaceae | Pedicularis wilhelmsiana | Ref. |
| Plantae | Paulowniaceae | Paulownia tomentosa | Ref. |
| Plantae | Pedaliaceae | Harpagophytum procumbens  | Ref. |
| Plantae | Plantaginaceae | Chelone obliqua | Ref. |
| Plantae | Plantaginaceae | Plantago afra  | Ref. |
| Plantae | Plantaginaceae | Plantago alpina | Ref. |
| Plantae | Plantaginaceae | Plantago altissima  | Ref. |
| Plantae | Plantaginaceae | Plantago arborescens | Ref. |
| Plantae | Plantaginaceae | Plantago arenaria  | Ref. |
| Plantae | Plantaginaceae | Plantago asiatica  | Ref. |
| Plantae | Plantaginaceae | Plantago australis | Ref. |
| Plantae | Plantaginaceae | Plantago bellardi | Ref. |
| Plantae | Plantaginaceae | Plantago bellardii | Ref. |
| Plantae | Plantaginaceae | Plantago cretica | Ref. |
| Plantae | Plantaginaceae | Plantago hookeriana | Ref. |
| Plantae | Plantaginaceae | Plantago lagopus | Ref. |
| Plantae | Plantaginaceae | Plantago lanceolata  | Ref. |
| Plantae | Plantaginaceae | Plantago lundborgii | Ref. |
| Plantae | Plantaginaceae | Plantago major  | Ref. |
| Plantae | Plantaginaceae | Plantago myosuros  | Ref. |
| Plantae | Plantaginaceae | Plantago nivalis | Ref. |
| Plantae | Plantaginaceae | Plantago ovata  | Ref. |
| Plantae | Plantaginaceae | Plantago patagonica | Ref. |
| Plantae | Plantaginaceae | Plantago raoulii | Ref. |
| Plantae | Plantaginaceae | Plantago sempervirens | Ref. |
| Plantae | Plantaginaceae | Plantago stauntonii | Ref. |
| Plantae | Plantaginaceae | Plantago subspathulata | Ref. |
| Plantae | Plantaginaceae | Plantago subulata | Ref. |
| Plantae | Plantaginaceae | Plantago uniflora | Ref. |
| Plantae | Plantaginaceae | Plantago webbii | Ref. |
| Plantae | Plantaginaceae | Sibthorpia africana L. | Ref. |
| Plantae | Plantaginaceae | Sibthorpia europea L. | Ref. |
| Plantae | Plantaginaceae | Veronica austriaca L.  | Ref. |
| Plantae | Plantaginaceae | Veronica montana | Ref. |
| Plantae | Plantaginaceae | Veronica persica  | Ref. |
| Plantae | Plantaginaceae | Veronica polita | Ref. |
| Plantae | Plantaginaceae | Veronica spuria | Ref. |
| Plantae | Rutaceae | Phellodendron amurense  | Ref. |
| Plantae | Scrophulariaceae | Camptoloma lyperiiflorum (Vatke) Hillard | Ref. |
| Plantae | Scrophulariaceae | Ellisiophyllum pinnatum (Wall.ex.Benth.) | Ref. |
| Plantae | Scrophulariaceae | Rehmannia glutinosa  | Ref. |
| Plantae | Scrophulariaceae | Scrophularia amplexicaulis | Ref. |
| Plantae | Scrophulariaceae | Scrophularia auriculata | Ref. |
| Plantae | Scrophulariaceae | Scrophularia canina  | Ref. |
| Plantae | Scrophulariaceae | Scrophularia dentata | Ref. |
| Plantae | Scrophulariaceae | Scrophularia ningpoensis  | Ref. |
| Plantae | Scrophulariaceae | Scrophularia nodosa L.  | Ref. |
| Plantae | Scrophulariaceae | Scrophularia scopolii | Ref. |
| Plantae | Scrophulariaceae | Scrophularia striata  | Ref. |
| Plantae | Scrophulariaceae | Verbascum mallophorum  | Ref. |
| Plantae | Scrophulariaceae | Verbascum phlomoides  | Ref. |
| Plantae | Scrophulariaceae | Verbascum sinuatum  | Ref. |
| Plantae | Scrophulariaceae | Verbascum wiedemannianum | Ref. |
| Plantae | Verbenaceae | Lantana sp. | Ref. |
| Plantae | Verbenaceae | Lippia alba  | Ref. |
| Plantae | Verbenaceae | Lippia dulcis TREV. | Ref. |
| Plantae | Verbenaceae | Verbena bonariensis  | Ref. |
| Plantae | Verbenaceae | Verbena brasiliensis | Ref. |
| Plantae | Verbenaceae | Verbena littoralis  | Ref. |
| Plantae | Verbenaceae | Verbena officinalis  | Ref. |
| Plantae | Verbenaceae | Verbenoxylum reitzii | Ref. |
| - | - | Baphicacanthus cusia  | Ref. |
| - | - | Galeobdolon chinense | Ref. |
| - | - | Pentemon gentianoides HBK | Ref. |
| - | - | Pithecotenium crucigerum (L.) A.H Gentry | Ref. |
|
|
zoom in
| Organism | Verbascum wiedemannianum | | Reference | Abougazar, et al., Planta Med, 69, (2003), 814.
Boje, et al., Planta Med, 69, (2003), 820.
Chen, Liu, et al., Determination of Effective Components in Traditional Chinese medicines, People's Medical Publishing House, Beijing, (2009).
Zou, et al., Chinese J of Pharm Analysis, 30, (2010), 160.
Pu, et al., Planta Med, 69, (2003), 65.
Martin-Nizard, et al., Planta Med, 69, (2003), 207.
Kirmizibekmez, et al., Planta Med, 70, (2004), 711.
Budzianowska, et al., Planta Med, 70, (2004), 834.
Lin, et al., Planta Med, 70, (2004), 50.
He, et al., Journal of Natural Products, 66, (2003), 851.
ONO, et al., Chem Pharm Bull, 53, (2005), 1175.
HARPUT, et al., Chem Pharm Bull, 50, (2002), 869.
Sahin, et al., Phytochemistry, 65, (2004), 2095.
Tanaka, et al., Chem Pharm Bull, 52, (2004), 1242.
Kanchanapoom, et al., Chem Pharm Bull, 52, (2004), 980.
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Chen, et al., China Journal of Chinese Materia Medica(Zhongguo Zhongyao Zazhi), 18, (1993), 424.
Jin, et al., China Journal of Chinese Materia Medica(Zhongguo Zhongyao Zazhi), 19, (1994), 695.
Ni, et al., China Journal of Chinese Materia Medica(Zhongguo Zhongyao Zazhi), 14, (1989), 41. |
|---|
|