| Name |
(-)-Eudesm-7(11)-en-4alpha-ol Juniper camphor |
| Formula |
C15H26O |
| Mw |
222.19836545 |
| CAS RN |
473-04-1 |
| C_ID |
C00038054
, 
|
| InChIKey |
STRABSCAWZINIF-JCUKGLBFNA-N |
| InChICode |
InChI=1S/C15H26O/c1-11(2)12-6-9-14(3)7-5-8-15(4,16)13(14)10-12/h13,16H,5-10H2,1-4H3/t13-,14-,15-/m1/s1 |
| SMILES |
CC(C)=C1CC[C@@]2(C)CCC[C@@](C)(O)[C@@H]2C1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Apiaceae | Daucus carota  | Ref. |
| Plantae | Asteraceae | Artemisia annua  | Ref. |
| Plantae | Asteraceae | Atractylodes macrocephala  | Ref. |
| Plantae | Cupressaceae | Juniperus communis  | Ref. |
| Plantae | Ericaceae | Rhododendron anthopogonoides | Ref. |
| Plantae | Ericaceae | Rhododendron capitatum | Ref. |
| Plantae | Meliaceae | Aglaia odorata  | Ref. |
| Plantae | Myricaceae | Myrica gale  | Ref. |
| Plantae | Myrtaceae | Psidium guajava  | Ref. |
| Plantae | Poaceae | Cymbopogon flexuosus  | Ref. |
| Plantae | Rutaceae | Clausena excavata  | Ref. |
| Plantae | Turneraceae | Turnera diffusa  | Ref. |
| Plantae | Valerianaceae/Linnaeaceae/Dipsacaceae/Diervillaceae | Valeriana officinalis  | Ref. |
| Plantae | Zingiberaceae | Curcuma longa  | Ref. |
| Plantae | Zingiberaceae | Zingiber cassumunar Roxb.  | Ref. |
| Plantae | Zingiberaceae | Zingiber officinale  | Ref. |
| - | - | Chiloscyphus polyanthos | Ref. |
|
|
zoom in
| Organism | Curcuma longa | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|