| Name |
alpha-Amorphene |
| Formula |
C15H24 |
| Mw |
204.18780077 |
| CAS RN |
20085-19-2 |
| C_ID |
C00035520
, 
|
| InChIKey |
QMAYBMKBYCGXDH-OSLIHGISNA-N |
| InChICode |
InChI=1S/C15H24/c1-10(2)13-8-6-12(4)14-7-5-11(3)9-15(13)14/h6,9-10,13-15H,5,7-8H2,1-4H3/t13-,14?,15-/m1/s1 |
| SMILES |
CC1=C[C@@H]2[C@H](CC1)C(C)=CC[C@@H]2C(C)C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Apiaceae | Daucus carota  | Ref. |
| Plantae | Araliaceae | Panax ginseng  | Ref. |
| Plantae | Asteraceae | Petasites albus  | Ref. |
| Plantae | Asteraceae | Tanacetum macrophyllum | Ref. |
| Plantae | Illiciaceae | Illicium anisatum  | Ref. |
| Plantae | Labiatae | Ocimum basilicum  | Ref. |
| Plantae | Labiatae | Salvia officinalis  | Ref. |
| Plantae | Labiatae | Satureja subspicata  | Ref. |
| Plantae | Lepidoziaceae | Lepidozia fauriana | Ref. |
| Plantae | Myrtaceae | Leptospermum scoparium  | Ref. |
| Plantae | Rutaceae | Citrus reticulata  | Ref. |
| Plantae | Solanaceae | Capsicum annuum  | Ref. |
| Plantae | Theaceae | Camellia sinensis  | Ref. |
| Plantae | Turneraceae | Turnera diffusa  | Ref. |
|
|
zoom in
| Organism | Turnera diffusa | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|