| Name |
Valencene |
| Formula |
C15H24 |
| Mw |
204.18780077 |
| CAS RN |
4630-07-3 |
| C_ID |
C00034741
, 
|
| InChIKey |
QEBNYNLSCGVZOH-ZECJTJDJNA-N |
| InChICode |
InChI=1S/C15H24/c1-11(2)13-8-9-14-7-5-6-12(3)15(14,4)10-13/h7,12-13H,1,5-6,8-10H2,2-4H3/t12-,13-,15+/m1/s1 |
| SMILES |
C=C(C)[C@@H]1CCC2=CCC[C@@H](C)[C@]2(C)C1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Anacardiaceae | Mangifera indica  | Ref. |
| Plantae | Apiaceae | Apium graveolens | Ref. |
| Plantae | Apiaceae | Daucus carota | Ref. |
| Plantae | Cannabaceae | Humulus lupulus | Ref. |
| Plantae | Cyperaceae | Cyperus rotundus | Ref. |
| Plantae | Gymnomitriaceae | Marsupella emarginata | Ref. |
| Plantae | Jubulaceae | Frullania pycnantha | Ref. |
| Plantae | Labiatae | Perilla frutescens | Ref. |
| Plantae | Labiatae | Pogostemon cablin | Ref. |
| Plantae | Labiatae | Rosmarinus officinalis | Ref. |
| Plantae | Labiatae | Satureja subspicata | Ref. |
| Plantae | Myrtaceae | Psidium guajava | Ref. |
| Plantae | Polygonaceae | Polygonum minus | Ref. |
| Plantae | Porellaceae | Porella acutifolia ssp.tosana | Ref. |
| Plantae | Primulaceae | Primula halleri | Ref. |
| Plantae | Rutaceae | Citrus limon | Ref. |
| Plantae | Rutaceae | Citrus reticulata | Ref. |
| Plantae | Rutaceae | Citrus sinensis L. | Ref. |
| Plantae | Solanaceae | Nicotiana tabacum | Ref. |
| Plantae | Valerianaceae | Nardostachys jatamansi | Ref. |
| Plantae | Valerianaceae/Linnaeaceae/Dipsacaceae/Diervillaceae | Valeriana officinalis | Ref. |
| Plantae | Zingiberaceae | Zingiber officinale | Ref. |
|
|
zoom in
| Organism | Porella acutifolia ssp.tosana |
|---|
| Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Hashimoto, et al., Phytochemistry, 53, (2000), 593 |
|---|
|
