| Name |
6,10,14-Trimethyl-2-pentadecanone Hexahydrofarnesyl acetone 6,10,14-Trimethylpentadecan-2-one Perhydrofarnesyl acetone Hexahydrofarnesy acetone |
| Formula |
C18H36O |
| Mw |
268.27661577 |
| CAS RN |
502-69-2 |
| C_ID |
C00030480
, 
|
| InChIKey |
WHWDWIHXSPCOKZ-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C18H36O/c1-15(2)9-6-10-16(3)11-7-12-17(4)13-8-14-18(5)19/h15-17H,6-14H2,1-5H3/t16-,17+/m1/s1 |
| SMILES |
CC(=O)CCCC(C)CCCC(C)CCCC(C)C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Acoraceae | Acorus calamus  | Ref. |
| Plantae | Asteraceae | Ambrosia trifida | Ref. |
| Plantae | Asteraceae | Anthemis aciphylla BOISS.var.discoidea BOISS | Ref. |
| Plantae | Asteraceae | Centaurea armena | Ref. |
| Plantae | Asteraceae | Centaurea sessilis | Ref. |
| Plantae | Asteraceae | Matricaria recutita  | Ref. |
| Plantae | Asteraceae | Petasites hybridus  | Ref. |
| Plantae | Asteraceae | Tanacetum macrophyllum | Ref. |
| Plantae | Ceratophyllaceae | Ceratophyllum demersum  | Ref. |
| Plantae | Cistaceae | Cistus creticus | Ref. |
| Plantae | Euphorbiaceae | Euphorbia helioscopia  | Ref. |
| Plantae | Fabaceae | Sophora japonica  | Ref. |
| Plantae | Fabaceae | Tipuana tipu | Ref. |
| Plantae | Fabaceae | Trifolium pratense  | Ref. |
| Plantae | Labiatae | Clinopodium nepeta | Ref. |
| Plantae | Labiatae | Perilla frutescens  | Ref. |
| Plantae | Meliaceae | Azadirachta indica  | Ref. |
| Plantae | Polygonaceae | Polygonum minus | Ref. |
| Plantae | Rosaceae | Prunus armeniaca L. (K113-40,K33-81)  | Ref. |
| Plantae | Rosaceae | Prunus salcina Lindl. (Blackamber) | Ref. |
| Plantae | Santalaceae | Santalum album  | Ref. |
| Plantae | Saururaceae | Houttuynia cordata  | Ref. |
| Plantae | Solanaceae | Mandragora autumnalis  | Ref. |
| Plantae | Solanaceae | Nicotiana tabacum  | Ref. |
| Plantae | Theaceae | Camellia sinensis  | Ref. |
| - | - | Caffea sp. | Ref. |
|
|
zoom in
| Organism | Trifolium pratense | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|