| Name |
Ethyl gallate Progallin A Ethy gallate |
| Formula |
C9H10O5 |
| Mw |
198.05282343 |
| CAS RN |
831-61-8 |
| C_ID |
C00030222
, 
|
| InChIKey |
VFPFQHQNJCMNBZ-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C9H10O5/c1-2-14-9(13)5-3-6(10)8(12)7(11)4-5/h3-4,10-12H,2H2,1H3 |
| SMILES |
CCOC(=O)c1cc(O)c(O)c(O)c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Anacardiaceae | Pistacia weinmannifolia J.Pisson ex.Franch  | Ref. |
| Plantae | Anacardiaceae | Rhus coriaria  | Ref. |
| Plantae | Asteraceae | Tagetes ercta | Ref. |
| Plantae | Combretaceae | Terminalia chebula  | Ref. |
| Plantae | Crassulaceae | Rhodiola crenulata | Ref. |
| Plantae | Crassulaceae | Rhodiola sacra | Ref. |
| Plantae | Fabaceae | Acacia arabica  | Ref. |
| Plantae | Fagaceae | Castanea mollissima  | Ref. |
| Plantae | Lythraceae | Punica granatum  | Ref. |
| Plantae | Malvaceae | Bombax malabaricum  | Ref. |
| Plantae | Nymphaeaceae | Nymphaea caerulea | Ref. |
| Plantae | Oxalidaceae | Oxalis corniculata  | Ref. |
| Plantae | Phyllanthaceae | Phyllanthus emblica  | Ref. |
| Plantae | Sapindaceae | Acer ginnala | Ref. |
| Plantae | Sapindaceae | Acer rubrum L.  | Ref. |
| Plantae | Vitaceae | Ampelopsis brevipedunculata  | Ref. |
| - | - | Haematoxylon campechianum  | Ref. |
|
|
zoom in
| Organism | Acer ginnala | | Reference | Chen, et al., Lexicon of Active Componentsin in Plants, Vol1, Medicinal Science and Technology Press of China, Beijing, (2001).
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Xu, et al., China Journal of Chinese Materia Medica(Zhongguo Zhongyao Zazhi), 20, (1995), 484. |
|---|
|