| Name |
beta-Amyrin acetate |
| Formula |
C32H52O2 |
| Mw |
468.3967309 |
| CAS RN |
1616-93-9 |
| C_ID |
C00022654
, 
|
| InChIKey |
UMRPOGLIBDXFNK-UOAIXHIYNA-N |
| InChICode |
InChI=1S/C32H52O2/c1-21(33)34-26-13-14-30(7)24(28(26,4)5)12-15-32(9)25(30)11-10-22-23-20-27(2,3)16-17-29(23,6)18-19-31(22,32)8/h10,23-26H,11-20H2,1-9H3/t23-,24-,25+,26-,29+,30-,31+,32+/m0/s1 |
| SMILES |
CC(=O)O[C@H]1CC[C@]2(C)[C@H]3CC=C4[C@@H]5CC(C)(C)CC[C@]5(C)CC[C@@]4(C)[C@]3(C)CC[C@H]2C1(C)C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Brachylaena ramiflora var. ramiflora | Ref. |
| Plantae | Asteraceae | Conyza aegyptica | Ref. |
| Plantae | Asteraceae | Taraxacum formosanum | Ref. |
| Plantae | Boraginaceae | Arnebia hispidissima | Ref. |
| Plantae | Boraginaceae | Arnebia nobilis | Ref. |
| Plantae | Boraginaceae | Heliotropium marifolium | Ref. |
| Plantae | Euphorbiaceae | Euphorbia larica | Ref. |
| Plantae | Euphorbiaceae | Euphorbia milli | Ref. |
| Plantae | Euphorbiaceae | Excoecaria agallocha L.  | Ref. |
| Plantae | Fagaceae | Quercus glauca Thunb.  | Ref. |
| Plantae | Fagaceae | Quercus myrsenaefolia | Ref. |
| Plantae | Fagaceae | Quercus stenophylla Makino. | Ref. |
| Plantae | Icacinaceae | Gonocaryum calleryanum  | Ref. |
| Plantae | Labiatae | Salvia mellifera | Ref. |
| Plantae | Labiatae | Salvia staminea | Ref. |
| Plantae | Lauraceae | Litsea elliptica | Ref. |
| Plantae | Loranthaceae | Loranthus falcatus  | Ref. |
| Plantae | Santalaceae | Viscum articulactum | Ref. |
| Plantae | Santalaceae | Viscum coloratum  | Ref. |
|
|
zoom in
| Organism | Salvia mellifera | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|