| Name |
alpha-Santalene |
| Formula |
C15H24 |
| Mw |
204.18780077 |
| CAS RN |
512-61-8 |
| C_ID |
C00021850
, 
|
| InChIKey |
KWFJIXPIFLVMPM-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C15H24/c1-10(2)6-5-7-14(3)11-8-12-13(9-11)15(12,14)4/h6,11-13H,5,7-9H2,1-4H3/t11-,12+,13-,14-,15+/m0/s1 |
| SMILES |
CC(C)=CCCC1(C)C2CC3C(C2)C31C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Annonaceae | Xylopia rubescens | Ref. |
| Plantae | Apiaceae | Daucus carota  | Ref. |
| Plantae | Araliaceae | Panax ginseng  | Ref. |
| Plantae | Asteraceae | Echinops grijsii | Ref. |
| Plantae | Asteraceae | Petasites albus  | Ref. |
| Plantae | Asteraceae | Petasites hybridus  | Ref. |
| Plantae | Asteraceae | Petasites japonicus  | Ref. |
| Plantae | Labiatae | Lavandula angustifolia  | Ref. |
| Plantae | Lauraceae | Cinnamomum camphora  | Ref. |
| Plantae | Rutaceae | Atalantia buxifolia | Ref. |
| Plantae | Rutaceae | Clausena lansium  | Ref. |
| Plantae | Rutaceae | Severinia buxifolia  | Ref. |
| Plantae | Santalaceae | Osyris tenuifolia | Ref. |
| Plantae | Santalaceae | Santalum album  | Ref. |
| Plantae | Santalaceae | Santalum spicatum | Ref. |
| Plantae | Schisandraceae | Schisandra chinensis  | Ref. |
| Plantae | Zingiberaceae | Zingiber officinale  | Ref. |
| - | - | Lavandin abrialis | Ref. |
|
|
zoom in
| Organism | Santalum album | | Reference | Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979).
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Wu, et al., JNP, 64, (2001), 1040 |
|---|
|