| Name |
alpha-Gurjunene |
| Formula |
C15H24 |
| Mw |
204.18780077 |
| CAS RN |
489-40-7 |
| C_ID |
C00021227
, 
|
| InChIKey |
SPCXZDDGSGTVAW-KRXFYZNUNA-N |
| InChICode |
InChI=1S/C15H24/c1-9-6-8-12-14(15(12,3)4)13-10(2)5-7-11(9)13/h9,11-12,14H,5-8H2,1-4H3/t9-,11-,12-,14-/m1/s1 |
| SMILES |
CC1=C2[C@H](CC1)[C@H](C)CC[C@@H]1[C@H]2C1(C)C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Acoraceae | Acorus calamus  | Ref. |
| Plantae | Anacardiaceae | Mangifera indica  | Ref. |
| Plantae | Annonaceae | Cananga odorata  | Ref. |
| Plantae | Apiaceae | Apium graveolens  | Ref. |
| Plantae | Araliaceae | Panax ginseng  | Ref. |
| Plantae | Asteraceae | Phagnalon sordidum | Ref. |
| Plantae | Asteraceae | Rhaponticum carthamoides  | Ref. |
| Plantae | Asteraceae | Tanacetum macrophyllum | Ref. |
| Plantae | Cannabaceae | Humulus lupulus  | Ref. |
| Plantae | Cistaceae | Cistus creticus | Ref. |
| Plantae | Cyperaceae | Cyperus rotundus L.  | Ref. |
| Plantae | Dipterocarpaceae | Dipterocarpus dyeri | Ref. |
| Plantae | Labiatae | Salvia officinalis  | Ref. |
| Plantae | Labiatae | Thymus broussonetti | Ref. |
| Plantae | Labiatae | Thymus maroccanus | Ref. |
| Plantae | Labiatae | Thymus praecos | Ref. |
| Plantae | Meliaceae | Azadirachta indica  | Ref. |
| Plantae | Meliaceae | Guarea macrophylla ssp.tuberculata | Ref. |
| Plantae | Myrtaceae | Leptospermum scoparium  | Ref. |
| Plantae | Myrtaceae | Myrtus communis  | Ref. |
| Plantae | Myrtaceae | Psidium guajava  | Ref. |
| Plantae | Piperaceae | Piper arboreum  | Ref. |
| Plantae | Piperaceae | Piper fimbriulatum | Ref. |
| Plantae | Piperaceae | Piper nigrum  | Ref. |
| Plantae | Piperaceae | Piper obliquum  | Ref. |
| Plantae | Rutaceae | Murraya paniculata  | Ref. |
| Plantae | Solanaceae | Solanum lycopersicum  | Ref. |
| Plantae | Solanaceae | Solanum tuberosum  | Ref. |
| Plantae | Valerianaceae/Linnaeaceae/Dipsacaceae/Diervillaceae | Valeriana officinalis  | Ref. |
| Plantae | Zingiberaceae | Zingiber officinale  | Ref. |
| - | - | Balsamum tolutanum | Ref. |
|
|
zoom in
| Organism | Thymus broussonetti | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|