| Name |
Viridiflorene Ledene Ledene Oxide |
| Formula |
C15H24 |
| Mw |
204.18780077 |
| CAS RN |
21747-46-6 |
| C_ID |
C00021220
, 
|
| InChIKey |
WGTRJVCFDUCKCM-PKIJNGNFNA-N |
| InChICode |
InChI=1S/C15H24/c1-9-6-8-12-14(15(12,3)4)13-10(2)5-7-11(9)13/h10,12-14H,5-8H2,1-4H3/t10-,12+,13+,14-/m0/s1 |
| SMILES |
CC1=C2CC[C@@H](C)C2[C@H]2[C@@H](CC1)C2(C)C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Animalia | Hominidae | Homo sapiens (Urine) | Ref. |
| Plantae | Anacardiaceae | Mangifera indica  | Ref. |
| Plantae | Araliaceae | Panax ginseng  | Ref. |
| Plantae | Asteraceae | Ageratina conyzoides | Ref. |
| Plantae | Asteraceae | Phagnalon sordidum | Ref. |
| Plantae | Cannabaceae | Humulus lupulus  | Ref. |
| Plantae | Cistaceae | Cistus creticus | Ref. |
| Plantae | Fabaceae | Rhynchosia minima  | Ref. |
| Plantae | Jubulaceae | Frullania ptychantha | Ref. |
| Plantae | Labiatae | Ocimum sanctum  | Ref. |
| Plantae | Labiatae | Perilla frutescens  | Ref. |
| Plantae | Labiatae | Thymus broussonetti | Ref. |
| Plantae | Labiatae | Thymus maroccanus | Ref. |
| Plantae | Labiatae | Thymus praecos | Ref. |
| Plantae | Lauraceae | Laurus nobilis  | Ref. |
| Plantae | Lepidoziaceae | Bazzania trilobata L. | Ref. |
| Plantae | Lepidoziaceae | Lepidozia vitrea | Ref. |
| Plantae | Meliaceae | Azadirachta indica  | Ref. |
| Plantae | Myrtaceae | Acca sellowiana | Ref. |
| Plantae | Myrtaceae | Eucalyptus microtheca  | Ref. |
| Plantae | Myrtaceae | Leptospermum scoparium  | Ref. |
| Plantae | Myrtaceae | Melaleuca alternifolia  | Ref. |
| Plantae | Myrtaceae | Melaleuca leucadendra L.  | Ref. |
| Plantae | Myrtaceae | Melaleuca leucadendron  | Ref. |
| Plantae | Piperaceae | Piper nigrum  | Ref. |
| Plantae | Rutaceae | Atalantia guillauminii | Ref. |
| Plantae | Valerianaceae/Linnaeaceae/Dipsacaceae/Diervillaceae | Valeriana officinalis  | Ref. |
| Plantae | Zingiberaceae | Zingiber officinale  | Ref. |
|
|
zoom in
| Organism | Thymus praecos | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|